C8H7NS — CID 142379201
5-but-3-en-1-ynyl-3-methyl-1,2-thiazole (PubChem CID 142379201) has the molecular formula C8H7NS and a molecular weight of 149.22 g/mol. Its IUPAC name is 5-but-3-en-1-ynyl-3-methyl-1,2-thiazole.
| Compound Name | 5-but-3-en-1-ynyl-3-methyl-1,2-thiazole |
|---|---|
| PubChem CID | 142379201 |
| Molecular Formula | C8H7NS |
| Molecular Weight | 149.22 g/mol |
| Exact Mass | 149.03 |
| IUPAC Name | 5-but-3-en-1-ynyl-3-methyl-1,2-thiazole |
| SMILES | C=CC#Cc1cc(C)ns1 |
| InChI | InChI=1S/C8H7NS/c1-3-4-5-8-6-7(2)9-10-8/h3,6H,1H2,2H3 |
| InChIKey | PWVVMTJTJITPNU-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.22 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|