About 2-(oxan-4-yl)-3,4-dihydro-2H-chromene-4,6-diol
2-(oxan-4-yl)-3,4-dihydro-2H-chromene-4,6-diol (PubChem CID 142380263) has the molecular formula C14H18O4
and a molecular weight of 250.29 g/mol. Its IUPAC name is 2-(oxan-4-yl)-3,4-dihydro-2H-chromene-4,6-diol.
Molecular Properties
| Compound Name | 2-(oxan-4-yl)-3,4-dihydro-2H-chromene-4,6-diol |
| PubChem CID | 142380263 |
| Molecular Formula | C14H18O4 |
| Molecular Weight | 250.29 g/mol |
| Exact Mass | 250.12 |
| IUPAC Name | 2-(oxan-4-yl)-3,4-dihydro-2H-chromene-4,6-diol |
| SMILES | Oc1ccc2c(c1)C(O)CC(C1CCOCC1)O2 |
| InChI | InChI=1S/C14H18O4/c15-10-1-2-13-11(7-10)12(16)8-14(18-13)9-3-5-17-6-4-9/h1-2,7,9,12,14-16H,3-6,8H2 |
| InChIKey | AWEDKQZHUPZGCK-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.29 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(oxan-4-yl)-3,4-dihydro-2H-chromene-4,6-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(oxan-4-yl)-3,4-dihydro-2H-chromene-4,6-diol?
The IUPAC name of 2-(oxan-4-yl)-3,4-dihydro-2H-chromene-4,6-diol (CID 142380263) is 2-(oxan-4-yl)-3,4-dihydro-2H-chromene-4,6-diol.
What is the SMILES notation for 2-(oxan-4-yl)-3,4-dihydro-2H-chromene-4,6-diol?
The canonical SMILES for 2-(oxan-4-yl)-3,4-dihydro-2H-chromene-4,6-diol is Oc1ccc2c(c1)C(O)CC(C1CCOCC1)O2.
What is the InChIKey of 2-(oxan-4-yl)-3,4-dihydro-2H-chromene-4,6-diol?
The InChIKey is AWEDKQZHUPZGCK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18O4/c15-10-1-2-13-11(7-10)12(16)8-14(18-13)9-3-5-17-6-4-9/h1-2,7,9,12,14-16H,3-6,8H2.
What are the key properties of 2-(oxan-4-yl)-3,4-dihydro-2H-chromene-4,6-diol?
2-(oxan-4-yl)-3,4-dihydro-2H-chromene-4,6-diol has a molecular weight of 250.29 g/mol, XLogP of 2.00, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(oxan-4-yl)-3,4-dihydro-2H-chromene-4,6-diol is sourced from PubChem (CID 142380263), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).