C24H24Cl2N4O2 — CID 142380893
1-[7-chloro-3-(2-chloro-3,5-dimethoxy-6-propylphenyl)-2,6-naphthyridin-1-yl]pyrrolidine-3-carbonitrile (PubChem CID 142380893) has the molecular formula C24H24Cl2N4O2 and a molecular weight of 471.39 g/mol. Its IUPAC name is 1-[7-chloro-3-(2-chloro-3,5-dimethoxy-6-propylphenyl)-2,6-naphthyridin-1-yl]pyrrolidine-3-carbonitrile.
| Compound Name | 1-[7-chloro-3-(2-chloro-3,5-dimethoxy-6-propylphenyl)-2,6-naphthyridin-1-yl]pyrrolidine-3-carbonitrile |
|---|---|
| PubChem CID | 142380893 |
| Molecular Formula | C24H24Cl2N4O2 |
| Molecular Weight | 471.39 g/mol |
| Exact Mass | 470.13 |
| IUPAC Name | 1-[7-chloro-3-(2-chloro-3,5-dimethoxy-6-propylphenyl)-2,6-naphthyridin-1-yl]pyrrolidine-3-carbonitrile |
| SMILES | CCCc1c(OC)cc(OC)c(Cl)c1-c1cc2cnc(Cl)cc2c(N2CCC(C#N)C2)n1 |
| InChI | InChI=1S/C24H24Cl2N4O2/c1-4-5-16-19(31-2)10-20(32-3)23(26)22(16)18-8-15-12-28-21(25)9-17(15)24(29-18)30-7-6-14(11-27)13-30/h8-10,12,14H,4-7,13H2,1-3H3 |
| InChIKey | XGSZFCFOAZGDQO-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 71.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.39 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|