About 3,4a,5,5a-tetrahydro-2H-cyclopropa[f][1,3]benzoxazole
3,4a,5,5a-tetrahydro-2H-cyclopropa[f][1,3]benzoxazole (PubChem CID 142381414) has the molecular formula C8H9NO
and a molecular weight of 135.17 g/mol. Its IUPAC name is 3,4a,5,5a-tetrahydro-2H-cyclopropa[f][1,3]benzoxazole.
Analyze 3,4a,5,5a-tetrahydro-2H-cyclopropa[f][1,3]benzoxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4a,5,5a-tetrahydro-2H-cyclopropa[f][1,3]benzoxazole?
The IUPAC name of 3,4a,5,5a-tetrahydro-2H-cyclopropa[f][1,3]benzoxazole (CID 142381414) is 3,4a,5,5a-tetrahydro-2H-cyclopropa[f][1,3]benzoxazole.
What is the SMILES notation for 3,4a,5,5a-tetrahydro-2H-cyclopropa[f][1,3]benzoxazole?
The canonical SMILES for 3,4a,5,5a-tetrahydro-2H-cyclopropa[f][1,3]benzoxazole is C1=C2NCOC2=CC2CC12.
What is the InChIKey of 3,4a,5,5a-tetrahydro-2H-cyclopropa[f][1,3]benzoxazole?
The InChIKey is JDMQCXVHDNKPCN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9NO/c1-5-2-7-8(3-6(1)5)10-4-9-7/h2-3,5-6,9H,1,4H2.
What are the key properties of 3,4a,5,5a-tetrahydro-2H-cyclopropa[f][1,3]benzoxazole?
3,4a,5,5a-tetrahydro-2H-cyclopropa[f][1,3]benzoxazole has a molecular weight of 135.17 g/mol, XLogP of 0.98, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4a,5,5a-tetrahydro-2H-cyclopropa[f][1,3]benzoxazole is sourced from PubChem (CID 142381414), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).