C18H18ClF2N3O2 — CID 142381459
8-chloro-6-(2,6-difluoro-3,5-dimethoxyphenyl)-2-methylpyrido[3,4-d]pyrimidine;ethane (PubChem CID 142381459) has the molecular formula C18H18ClF2N3O2 and a molecular weight of 381.81 g/mol. Its IUPAC name is 8-chloro-6-(2,6-difluoro-3,5-dimethoxyphenyl)-2-methylpyrido[3,4-d]pyrimidine;ethane.
| Compound Name | 8-chloro-6-(2,6-difluoro-3,5-dimethoxyphenyl)-2-methylpyrido[3,4-d]pyrimidine;ethane |
|---|---|
| PubChem CID | 142381459 |
| Molecular Formula | C18H18ClF2N3O2 |
| Molecular Weight | 381.81 g/mol |
| Exact Mass | 381.11 |
| IUPAC Name | 8-chloro-6-(2,6-difluoro-3,5-dimethoxyphenyl)-2-methylpyrido[3,4-d]pyrimidine;ethane |
| SMILES | CC.COc1cc(OC)c(F)c(-c2cc3cnc(C)nc3c(Cl)n2)c1F |
| InChI | InChI=1S/C16H12ClF2N3O2.C2H6/c1-7-20-6-8-4-9(22-16(17)15(8)21-7)12-13(18)10(23-2)5-11(24-3)14(12)19;1-2/h4-6H,1-3H3;1-2H3 |
| InChIKey | HRHACHTXERMXOY-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 57.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.81 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|