About 5-(2,6-dichloro-3,5-dimethoxyphenyl)-3-ethenylthiophen-2-amine
5-(2,6-dichloro-3,5-dimethoxyphenyl)-3-ethenylthiophen-2-amine (PubChem CID 142381479) has the molecular formula C14H13Cl2NO2S
and a molecular weight of 330.24 g/mol. Its IUPAC name is 5-(2,6-dichloro-3,5-dimethoxyphenyl)-3-ethenylthiophen-2-amine.
Molecular Properties
| Compound Name | 5-(2,6-dichloro-3,5-dimethoxyphenyl)-3-ethenylthiophen-2-amine |
| PubChem CID | 142381479 |
| Molecular Formula | C14H13Cl2NO2S |
| Molecular Weight | 330.24 g/mol |
| Exact Mass | 329.00 |
| IUPAC Name | 5-(2,6-dichloro-3,5-dimethoxyphenyl)-3-ethenylthiophen-2-amine |
| SMILES | C=Cc1cc(-c2c(Cl)c(OC)cc(OC)c2Cl)sc1N |
| InChI | InChI=1S/C14H13Cl2NO2S/c1-4-7-5-10(20-14(7)17)11-12(15)8(18-2)6-9(19-3)13(11)16/h4-6H,1,17H2,2-3H3 |
| InChIKey | AMVUGHRUCPULBB-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.24 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-(2,6-dichloro-3,5-dimethoxyphenyl)-3-ethenylthiophen-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2,6-dichloro-3,5-dimethoxyphenyl)-3-ethenylthiophen-2-amine?
The IUPAC name of 5-(2,6-dichloro-3,5-dimethoxyphenyl)-3-ethenylthiophen-2-amine (CID 142381479) is 5-(2,6-dichloro-3,5-dimethoxyphenyl)-3-ethenylthiophen-2-amine.
What is the SMILES notation for 5-(2,6-dichloro-3,5-dimethoxyphenyl)-3-ethenylthiophen-2-amine?
The canonical SMILES for 5-(2,6-dichloro-3,5-dimethoxyphenyl)-3-ethenylthiophen-2-amine is C=Cc1cc(-c2c(Cl)c(OC)cc(OC)c2Cl)sc1N.
What is the InChIKey of 5-(2,6-dichloro-3,5-dimethoxyphenyl)-3-ethenylthiophen-2-amine?
The InChIKey is AMVUGHRUCPULBB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13Cl2NO2S/c1-4-7-5-10(20-14(7)17)11-12(15)8(18-2)6-9(19-3)13(11)16/h4-6H,1,17H2,2-3H3.
What are the key properties of 5-(2,6-dichloro-3,5-dimethoxyphenyl)-3-ethenylthiophen-2-amine?
5-(2,6-dichloro-3,5-dimethoxyphenyl)-3-ethenylthiophen-2-amine has a molecular weight of 330.24 g/mol, XLogP of 4.96, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2,6-dichloro-3,5-dimethoxyphenyl)-3-ethenylthiophen-2-amine is sourced from PubChem (CID 142381479), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).