C24H23F5NO3P — CID 142381576
2-methyl-1-[(2-methylphenyl)methoxy]-N-[(2,3,4,5,6-pentafluorophenoxy)-phenoxyphosphanyl]propan-2-amine (PubChem CID 142381576) has the molecular formula C24H23F5NO3P and a molecular weight of 499.42 g/mol. Its IUPAC name is 2-methyl-1-[(2-methylphenyl)methoxy]-N-[(2,3,4,5,6-pentafluorophenoxy)-phenoxyphosphanyl]propan-2-amine.
| Compound Name | 2-methyl-1-[(2-methylphenyl)methoxy]-N-[(2,3,4,5,6-pentafluorophenoxy)-phenoxyphosphanyl]propan-2-amine |
|---|---|
| PubChem CID | 142381576 |
| Molecular Formula | C24H23F5NO3P |
| Molecular Weight | 499.42 g/mol |
| Exact Mass | 499.13 |
| IUPAC Name | 2-methyl-1-[(2-methylphenyl)methoxy]-N-[(2,3,4,5,6-pentafluorophenoxy)-phenoxyphosphanyl]propan-2-amine |
| SMILES | Cc1ccccc1COCC(C)(C)NP(Oc1ccccc1)Oc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C24H23F5NO3P/c1-15-9-7-8-10-16(15)13-31-14-24(2,3)30-34(32-17-11-5-4-6-12-17)33-23-21(28)19(26)18(25)20(27)22(23)29/h4-12,30H,13-14H2,1-3H3 |
| InChIKey | QVCIBRXAWZICOS-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.42 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|