About pentane-2,3,4-triimine
pentane-2,3,4-triimine (PubChem CID 142381690) has the molecular formula C5H9N3
and a molecular weight of 111.15 g/mol. Its IUPAC name is pentane-2,3,4-triimine.
Molecular Properties
| Compound Name | pentane-2,3,4-triimine |
| PubChem CID | 142381690 |
| Molecular Formula | C5H9N3 |
| Molecular Weight | 111.15 g/mol |
| Exact Mass | 111.08 |
| IUPAC Name | pentane-2,3,4-triimine |
| SMILES | [H]N=C(/C(C)=N/[H])/C(C)=N/[H] |
| InChI | InChI=1S/C5H9N3/c1-3(6)5(8)4(2)7/h6-8H,1-2H3/b6-3+,7-4+ |
| InChIKey | BPJHSAMAEHYOSH-XOKGJFMYSA-N |
| XLogP | 1.09 |
| TPSA | 71.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 111.15 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze pentane-2,3,4-triimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pentane-2,3,4-triimine?
The IUPAC name of pentane-2,3,4-triimine (CID 142381690) is pentane-2,3,4-triimine.
What is the SMILES notation for pentane-2,3,4-triimine?
The canonical SMILES for pentane-2,3,4-triimine is [H]N=C(/C(C)=N/[H])/C(C)=N/[H].
What is the InChIKey of pentane-2,3,4-triimine?
The InChIKey is BPJHSAMAEHYOSH-XOKGJFMYSA-N. The full InChI is InChI=1S/C5H9N3/c1-3(6)5(8)4(2)7/h6-8H,1-2H3/b6-3+,7-4+.
What are the key properties of pentane-2,3,4-triimine?
pentane-2,3,4-triimine has a molecular weight of 111.15 g/mol, XLogP of 1.09, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for pentane-2,3,4-triimine is sourced from PubChem (CID 142381690), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).