About 4-(furan-2-yl)furo[2,3-f][1]benzofuran
4-(furan-2-yl)furo[2,3-f][1]benzofuran (PubChem CID 142381848) has the molecular formula C14H8O3
and a molecular weight of 224.22 g/mol. Its IUPAC name is 4-(furan-2-yl)furo[2,3-f][1]benzofuran.
Molecular Properties
| Compound Name | 4-(furan-2-yl)furo[2,3-f][1]benzofuran |
| PubChem CID | 142381848 |
| Molecular Formula | C14H8O3 |
| Molecular Weight | 224.22 g/mol |
| Exact Mass | 224.05 |
| IUPAC Name | 4-(furan-2-yl)furo[2,3-f][1]benzofuran |
| SMILES | c1coc(-c2c3ccoc3cc3ccoc23)c1 |
| InChI | InChI=1S/C14H8O3/c1-2-11(15-5-1)13-10-4-7-16-12(10)8-9-3-6-17-14(9)13/h1-8H |
| InChIKey | VTHYMLTZULIDPA-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 39.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.22 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(furan-2-yl)furo[2,3-f][1]benzofuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(furan-2-yl)furo[2,3-f][1]benzofuran?
The IUPAC name of 4-(furan-2-yl)furo[2,3-f][1]benzofuran (CID 142381848) is 4-(furan-2-yl)furo[2,3-f][1]benzofuran.
What is the SMILES notation for 4-(furan-2-yl)furo[2,3-f][1]benzofuran?
The canonical SMILES for 4-(furan-2-yl)furo[2,3-f][1]benzofuran is c1coc(-c2c3ccoc3cc3ccoc23)c1.
What is the InChIKey of 4-(furan-2-yl)furo[2,3-f][1]benzofuran?
The InChIKey is VTHYMLTZULIDPA-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H8O3/c1-2-11(15-5-1)13-10-4-7-16-12(10)8-9-3-6-17-14(9)13/h1-8H.
What are the key properties of 4-(furan-2-yl)furo[2,3-f][1]benzofuran?
4-(furan-2-yl)furo[2,3-f][1]benzofuran has a molecular weight of 224.22 g/mol, XLogP of 4.44, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(furan-2-yl)furo[2,3-f][1]benzofuran is sourced from PubChem (CID 142381848), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).