C26H28FN5O3 — CID 142382265
N-[4-(3,4-dimethoxyphenyl)-3-(N-hydrazinylidenecarbamimidoyl)phenyl]-1-[(3E)-5-fluoro-2-methylhexa-1,3,5-trien-3-yl]cyclopropane-1-carboxamide (PubChem CID 142382265) has the molecular formula C26H28FN5O3 and a molecular weight of 477.54 g/mol. Its IUPAC name is N-[4-(3,4-dimethoxyphenyl)-3-(N-hydrazinylidenecarbamimidoyl)phenyl]-1-[(3E)-5-fluoro-2-methylhexa-1,3,5-trien-3-yl]cyclopropane-1-carboxamide.
| Compound Name | N-[4-(3,4-dimethoxyphenyl)-3-(N-hydrazinylidenecarbamimidoyl)phenyl]-1-[(3E)-5-fluoro-2-methylhexa-1,3,5-trien-3-yl]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 142382265 |
| Molecular Formula | C26H28FN5O3 |
| Molecular Weight | 477.54 g/mol |
| Exact Mass | 477.22 |
| IUPAC Name | N-[4-(3,4-dimethoxyphenyl)-3-(N-hydrazinylidenecarbamimidoyl)phenyl]-1-[(3E)-5-fluoro-2-methylhexa-1,3,5-trien-3-yl]cyclopropane-1-carboxamide |
| SMILES | [H]/N=C(\N=N\N)c1cc(NC(=O)C2(/C(=C/C(=C)F)C(=C)C)CC2)ccc1-c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C26H28FN5O3/c1-15(2)21(12-16(3)27)26(10-11-26)25(33)30-18-7-8-19(20(14-18)24(28)31-32-29)17-6-9-22(34-4)23(13-17)35-5/h6-9,12-14H,1,3,10-11H2,2,4-5H3,(H,30,33)(H3,28,29,31)/b21-12+ |
| InChIKey | YOXWAIVOVIQTNM-CIAFOILYSA-N |
| XLogP | 5.73 |
| TPSA | 122.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.54 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|