C22H18Cl2F4N4O4S — CID 142382379
4-[5-(3,6-dichloro-5-fluorocyclohepta-1,3,4,6-tetraen-1-yl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-2-methyl-N-(1-sulfamoylazetidin-3-yl)benzamide (PubChem CID 142382379) has the molecular formula C22H18Cl2F4N4O4S and a molecular weight of 581.38 g/mol. Its IUPAC name is 4-[5-(3,6-dichloro-5-fluorocyclohepta-1,3,4,6-tetraen-1-yl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-2-methyl-N-(1-sulfamoylazetidin-3-yl)benzamide.
| Compound Name | 4-[5-(3,6-dichloro-5-fluorocyclohepta-1,3,4,6-tetraen-1-yl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-2-methyl-N-(1-sulfamoylazetidin-3-yl)benzamide |
|---|---|
| PubChem CID | 142382379 |
| Molecular Formula | C22H18Cl2F4N4O4S |
| Molecular Weight | 581.38 g/mol |
| Exact Mass | 580.04 |
| IUPAC Name | 4-[5-(3,6-dichloro-5-fluorocyclohepta-1,3,4,6-tetraen-1-yl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-2-methyl-N-(1-sulfamoylazetidin-3-yl)benzamide |
| SMILES | Cc1cc(C2=NOC(C3=CC(Cl)=C=C(F)C(Cl)=C3)(C(F)(F)F)C2)ccc1C(=O)NC1CN(S(N)(=O)=O)C1 |
| InChI | InChI=1S/C22H18Cl2F4N4O4S/c1-11-4-12(2-3-16(11)20(33)30-15-9-32(10-15)37(29,34)35)19-8-21(36-31-19,22(26,27)28)13-5-14(23)7-18(25)17(24)6-13/h2-6,15H,8-10H2,1H3,(H,30,33)(H2,29,34,35) |
| InChIKey | FXGBTTVUBVNFKU-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 114.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.38 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |