C23H21NO2S — CID 142382537
11-[(2E,4E)-2-hydroxyhepta-2,4-dien-4-yl]-5,11-dihydroindeno[2,1-c][1,5]benzothiazepin-12-one (PubChem CID 142382537) has the molecular formula C23H21NO2S and a molecular weight of 375.49 g/mol. Its IUPAC name is 11-[(2E,4E)-2-hydroxyhepta-2,4-dien-4-yl]-5,11-dihydroindeno[2,1-c][1,5]benzothiazepin-12-one.
| Compound Name | 11-[(2E,4E)-2-hydroxyhepta-2,4-dien-4-yl]-5,11-dihydroindeno[2,1-c][1,5]benzothiazepin-12-one |
|---|---|
| PubChem CID | 142382537 |
| Molecular Formula | C23H21NO2S |
| Molecular Weight | 375.49 g/mol |
| Exact Mass | 375.13 |
| IUPAC Name | 11-[(2E,4E)-2-hydroxyhepta-2,4-dien-4-yl]-5,11-dihydroindeno[2,1-c][1,5]benzothiazepin-12-one |
| SMILES | CC/C=C(\C=C(/C)O)C1Sc2ccccc2NC2=C1C(=O)c1ccccc12 |
| InChI | InChI=1S/C23H21NO2S/c1-3-8-15(13-14(2)25)23-20-21(16-9-4-5-10-17(16)22(20)26)24-18-11-6-7-12-19(18)27-23/h4-13,23-25H,3H2,1-2H3/b14-13+,15-8+ |
| InChIKey | IBEYGDQHHLOVHP-RIJNBSGKSA-N |
| XLogP | 5.98 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.49 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|