C15H22OTe — CID 142383242
(3S)-2-(cyclohex-2-en-1-ylmethyl)-3,4,5-trimethyl-3H-tellurophene-2-carbaldehyde (PubChem CID 142383242) has the molecular formula C15H22OTe and a molecular weight of 345.94 g/mol. Its IUPAC name is (3S)-2-(cyclohex-2-en-1-ylmethyl)-3,4,5-trimethyl-3H-tellurophene-2-carbaldehyde.
| Compound Name | (3S)-2-(cyclohex-2-en-1-ylmethyl)-3,4,5-trimethyl-3H-tellurophene-2-carbaldehyde |
|---|---|
| PubChem CID | 142383242 |
| Molecular Formula | C15H22OTe |
| Molecular Weight | 345.94 g/mol |
| Exact Mass | 348.07 |
| IUPAC Name | (3S)-2-(cyclohex-2-en-1-ylmethyl)-3,4,5-trimethyl-3H-tellurophene-2-carbaldehyde |
| SMILES | CC1=C(C)[C@H](C)C(C=O)(CC2C=CCCC2)[Te]1 |
| InChI | InChI=1S/C15H22OTe/c1-11-12(2)15(10-16,17-13(11)3)9-14-7-5-4-6-8-14/h5,7,10,12,14H,4,6,8-9H2,1-3H3/t12-,14?,15?/m0/s1 |
| InChIKey | GGADYUXRCIOPED-GRTSSRMGSA-N |
| XLogP | 3.74 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.94 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|