About 2-cyclohexyl-3-methoxypent-1-ene-3-thiol;4,4-dimethylpent-1-ene
2-cyclohexyl-3-methoxypent-1-ene-3-thiol;4,4-dimethylpent-1-ene (PubChem CID 142384025) has the molecular formula C19H36OS
and a molecular weight of 312.56 g/mol. Its IUPAC name is 2-cyclohexyl-3-methoxypent-1-ene-3-thiol;4,4-dimethylpent-1-ene.
Molecular Properties
| Compound Name | 2-cyclohexyl-3-methoxypent-1-ene-3-thiol;4,4-dimethylpent-1-ene |
| PubChem CID | 142384025 |
| Molecular Formula | C19H36OS |
| Molecular Weight | 312.56 g/mol |
| Exact Mass | 312.25 |
| IUPAC Name | 2-cyclohexyl-3-methoxypent-1-ene-3-thiol;4,4-dimethylpent-1-ene |
| SMILES | C=C(C1CCCCC1)C(S)(CC)OC.C=CCC(C)(C)C |
| InChI | InChI=1S/C12H22OS.C7H14/c1-4-12(14,13-3)10(2)11-8-6-5-7-9-11;1-5-6-7(2,3)4/h11,14H,2,4-9H2,1,3H3;5H,1,6H2,2-4H3 |
| InChIKey | XWFTZBFIQPIQLT-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 9.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 312.56 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2-cyclohexyl-3-methoxypent-1-ene-3-thiol;4,4-dimethylpent-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclohexyl-3-methoxypent-1-ene-3-thiol;4,4-dimethylpent-1-ene?
The IUPAC name of 2-cyclohexyl-3-methoxypent-1-ene-3-thiol;4,4-dimethylpent-1-ene (CID 142384025) is 2-cyclohexyl-3-methoxypent-1-ene-3-thiol;4,4-dimethylpent-1-ene.
What is the SMILES notation for 2-cyclohexyl-3-methoxypent-1-ene-3-thiol;4,4-dimethylpent-1-ene?
The canonical SMILES for 2-cyclohexyl-3-methoxypent-1-ene-3-thiol;4,4-dimethylpent-1-ene is C=C(C1CCCCC1)C(S)(CC)OC.C=CCC(C)(C)C.
What is the InChIKey of 2-cyclohexyl-3-methoxypent-1-ene-3-thiol;4,4-dimethylpent-1-ene?
The InChIKey is XWFTZBFIQPIQLT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22OS.C7H14/c1-4-12(14,13-3)10(2)11-8-6-5-7-9-11;1-5-6-7(2,3)4/h11,14H,2,4-9H2,1,3H3;5H,1,6H2,2-4H3.
What are the key properties of 2-cyclohexyl-3-methoxypent-1-ene-3-thiol;4,4-dimethylpent-1-ene?
2-cyclohexyl-3-methoxypent-1-ene-3-thiol;4,4-dimethylpent-1-ene has a molecular weight of 312.56 g/mol, XLogP of 6.41, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclohexyl-3-methoxypent-1-ene-3-thiol;4,4-dimethylpent-1-ene is sourced from PubChem (CID 142384025), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).