C32H22F2N4O3S — CID 142384417
N-[(2R)-1-(1,3-dioxoisoindol-2-yl)-3-pyridin-2-ylpropan-2-yl]-3-fluoro-2-[5-(4-fluorophenyl)-1,3-thiazol-2-yl]benzamide (PubChem CID 142384417) has the molecular formula C32H22F2N4O3S and a molecular weight of 580.62 g/mol. Its IUPAC name is N-[(2R)-1-(1,3-dioxoisoindol-2-yl)-3-pyridin-2-ylpropan-2-yl]-3-fluoro-2-[5-(4-fluorophenyl)-1,3-thiazol-2-yl]benzamide.
| Compound Name | N-[(2R)-1-(1,3-dioxoisoindol-2-yl)-3-pyridin-2-ylpropan-2-yl]-3-fluoro-2-[5-(4-fluorophenyl)-1,3-thiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 142384417 |
| Molecular Formula | C32H22F2N4O3S |
| Molecular Weight | 580.62 g/mol |
| Exact Mass | 580.14 |
| IUPAC Name | N-[(2R)-1-(1,3-dioxoisoindol-2-yl)-3-pyridin-2-ylpropan-2-yl]-3-fluoro-2-[5-(4-fluorophenyl)-1,3-thiazol-2-yl]benzamide |
| SMILES | O=C(N[C@H](Cc1ccccn1)CN1C(=O)c2ccccc2C1=O)c1cccc(F)c1-c1ncc(-c2ccc(F)cc2)s1 |
| InChI | InChI=1S/C32H22F2N4O3S/c33-20-13-11-19(12-14-20)27-17-36-30(42-27)28-25(9-5-10-26(28)34)29(39)37-22(16-21-6-3-4-15-35-21)18-38-31(40)23-7-1-2-8-24(23)32(38)41/h1-15,17,22H,16,18H2,(H,37,39)/t22-/m1/s1 |
| InChIKey | GBPVAVLLMQUSSM-JOCHJYFZSA-N |
| XLogP | 5.79 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.62 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|