C13H18FNO — CID 142385504
(E)-N-[(2E,4E)-2-ethenyl-5-fluorohexa-2,4-dienyl]pent-2-enamide (PubChem CID 142385504) has the molecular formula C13H18FNO and a molecular weight of 223.29 g/mol. Its IUPAC name is (E)-N-[(2E,4E)-2-ethenyl-5-fluorohexa-2,4-dienyl]pent-2-enamide.
| Compound Name | (E)-N-[(2E,4E)-2-ethenyl-5-fluorohexa-2,4-dienyl]pent-2-enamide |
|---|---|
| PubChem CID | 142385504 |
| Molecular Formula | C13H18FNO |
| Molecular Weight | 223.29 g/mol |
| Exact Mass | 223.14 |
| IUPAC Name | (E)-N-[(2E,4E)-2-ethenyl-5-fluorohexa-2,4-dienyl]pent-2-enamide |
| SMILES | C=C/C(=C\C=C(/C)F)CNC(=O)/C=C/CC |
| InChI | InChI=1S/C13H18FNO/c1-4-6-7-13(16)15-10-12(5-2)9-8-11(3)14/h5-9H,2,4,10H2,1,3H3,(H,15,16)/b7-6+,11-8+,12-9+ |
| InChIKey | HBYWEWITPFKHLD-XQYGDOFQSA-N |
| XLogP | 3.05 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.29 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|