C22H34ClFN2 — CID 142385584
N-[(3-chloro-3,6-dimethylcyclohepta-1,6-dien-4-yn-1-yl)methyl]-1-[1-(3,3-dimethylbutyl)-3-fluoropiperidin-4-yl]methanamine (PubChem CID 142385584) has the molecular formula C22H34ClFN2 and a molecular weight of 380.98 g/mol. Its IUPAC name is N-[(3-chloro-3,6-dimethylcyclohepta-1,6-dien-4-yn-1-yl)methyl]-1-[1-(3,3-dimethylbutyl)-3-fluoropiperidin-4-yl]methanamine.
| Compound Name | N-[(3-chloro-3,6-dimethylcyclohepta-1,6-dien-4-yn-1-yl)methyl]-1-[1-(3,3-dimethylbutyl)-3-fluoropiperidin-4-yl]methanamine |
|---|---|
| PubChem CID | 142385584 |
| Molecular Formula | C22H34ClFN2 |
| Molecular Weight | 380.98 g/mol |
| Exact Mass | 380.24 |
| IUPAC Name | N-[(3-chloro-3,6-dimethylcyclohepta-1,6-dien-4-yn-1-yl)methyl]-1-[1-(3,3-dimethylbutyl)-3-fluoropiperidin-4-yl]methanamine |
| SMILES | CC1=CC(CNCC2CCN(CCC(C)(C)C)CC2F)=CC(C)(Cl)C#C1 |
| InChI | InChI=1S/C22H34ClFN2/c1-17-6-8-22(5,23)13-18(12-17)14-25-15-19-7-10-26(16-20(19)24)11-9-21(2,3)4/h12-13,19-20,25H,7,9-11,14-16H2,1-5H3 |
| InChIKey | PNZJNCSXJPQMTM-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.98 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|