About ethane;1-(2,2,4-trimethyl-4-methylsulfanylpentyl)piperazine
ethane;1-(2,2,4-trimethyl-4-methylsulfanylpentyl)piperazine (PubChem CID 142386021) has the molecular formula C15H34N2S
and a molecular weight of 274.52 g/mol. Its IUPAC name is ethane;1-(2,2,4-trimethyl-4-methylsulfanylpentyl)piperazine.
Molecular Properties
| Compound Name | ethane;1-(2,2,4-trimethyl-4-methylsulfanylpentyl)piperazine |
| PubChem CID | 142386021 |
| Molecular Formula | C15H34N2S |
| Molecular Weight | 274.52 g/mol |
| Exact Mass | 274.24 |
| IUPAC Name | ethane;1-(2,2,4-trimethyl-4-methylsulfanylpentyl)piperazine |
| SMILES | CC.CSC(C)(C)CC(C)(C)CN1CCNCC1 |
| InChI | InChI=1S/C13H28N2S.C2H6/c1-12(2,10-13(3,4)16-5)11-15-8-6-14-7-9-15;1-2/h14H,6-11H2,1-5H3;1-2H3 |
| InChIKey | DGMWDJBMGQEPFP-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.52 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethane;1-(2,2,4-trimethyl-4-methylsulfanylpentyl)piperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-(2,2,4-trimethyl-4-methylsulfanylpentyl)piperazine?
The IUPAC name of ethane;1-(2,2,4-trimethyl-4-methylsulfanylpentyl)piperazine (CID 142386021) is ethane;1-(2,2,4-trimethyl-4-methylsulfanylpentyl)piperazine.
What is the SMILES notation for ethane;1-(2,2,4-trimethyl-4-methylsulfanylpentyl)piperazine?
The canonical SMILES for ethane;1-(2,2,4-trimethyl-4-methylsulfanylpentyl)piperazine is CC.CSC(C)(C)CC(C)(C)CN1CCNCC1.
What is the InChIKey of ethane;1-(2,2,4-trimethyl-4-methylsulfanylpentyl)piperazine?
The InChIKey is DGMWDJBMGQEPFP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H28N2S.C2H6/c1-12(2,10-13(3,4)16-5)11-15-8-6-14-7-9-15;1-2/h14H,6-11H2,1-5H3;1-2H3.
What are the key properties of ethane;1-(2,2,4-trimethyl-4-methylsulfanylpentyl)piperazine?
ethane;1-(2,2,4-trimethyl-4-methylsulfanylpentyl)piperazine has a molecular weight of 274.52 g/mol, XLogP of 3.48, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-(2,2,4-trimethyl-4-methylsulfanylpentyl)piperazine is sourced from PubChem (CID 142386021), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).