C29H57N3 — CID 142386099
(1S,4S)-2-tert-butyl-5-[2,4-dimethyl-4-[1-(2,3,3-trimethylpentan-2-yl)piperidin-4-yl]pentan-2-yl]-2,5-diazabicyclo[2.2.1]heptane (PubChem CID 142386099) has the molecular formula C29H57N3 and a molecular weight of 447.80 g/mol. Its IUPAC name is (1S,4S)-2-tert-butyl-5-[2,4-dimethyl-4-[1-(2,3,3-trimethylpentan-2-yl)piperidin-4-yl]pentan-2-yl]-2,5-diazabicyclo[2.2.1]heptane.
| Compound Name | (1S,4S)-2-tert-butyl-5-[2,4-dimethyl-4-[1-(2,3,3-trimethylpentan-2-yl)piperidin-4-yl]pentan-2-yl]-2,5-diazabicyclo[2.2.1]heptane |
|---|---|
| PubChem CID | 142386099 |
| Molecular Formula | C29H57N3 |
| Molecular Weight | 447.80 g/mol |
| Exact Mass | 447.46 |
| IUPAC Name | (1S,4S)-2-tert-butyl-5-[2,4-dimethyl-4-[1-(2,3,3-trimethylpentan-2-yl)piperidin-4-yl]pentan-2-yl]-2,5-diazabicyclo[2.2.1]heptane |
| SMILES | CCC(C)(C)C(C)(C)N1CCC(C(C)(C)CC(C)(C)N2C[C@@H]3C[C@H]2CN3C(C)(C)C)CC1 |
| InChI | InChI=1S/C29H57N3/c1-13-27(7,8)29(11,12)30-16-14-22(15-17-30)26(5,6)21-28(9,10)32-20-23-18-24(32)19-31(23)25(2,3)4/h22-24H,13-21H2,1-12H3/t23-,24-/m0/s1 |
| InChIKey | QDMNBQUBRNZAPN-ZEQRLZLVSA-N |
| XLogP | 6.67 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.80 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |