C15H33F2N3 — CID 142386293
2,2-difluoro-8-(4-methylpiperazin-1-yl)octan-1-amine;ethane (PubChem CID 142386293) has the molecular formula C15H33F2N3 and a molecular weight of 293.45 g/mol. Its IUPAC name is 2,2-difluoro-8-(4-methylpiperazin-1-yl)octan-1-amine;ethane.
| Compound Name | 2,2-difluoro-8-(4-methylpiperazin-1-yl)octan-1-amine;ethane |
|---|---|
| PubChem CID | 142386293 |
| Molecular Formula | C15H33F2N3 |
| Molecular Weight | 293.45 g/mol |
| Exact Mass | 293.26 |
| IUPAC Name | 2,2-difluoro-8-(4-methylpiperazin-1-yl)octan-1-amine;ethane |
| SMILES | CC.CN1CCN(CCCCCCC(F)(F)CN)CC1 |
| InChI | InChI=1S/C13H27F2N3.C2H6/c1-17-8-10-18(11-9-17)7-5-3-2-4-6-13(14,15)12-16;1-2/h2-12,16H2,1H3;1-2H3 |
| InChIKey | BKXMEKGVYVTRAC-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.45 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|