About 2-(3,3-dimethylbut-1-ynyl)-5-(3-methoxycyclobutyl)oxy-4-(trifluoromethyl)pyridine
2-(3,3-dimethylbut-1-ynyl)-5-(3-methoxycyclobutyl)oxy-4-(trifluoromethyl)pyridine (PubChem CID 142386312) has the molecular formula C17H20F3NO2
and a molecular weight of 327.35 g/mol. Its IUPAC name is 2-(3,3-dimethylbut-1-ynyl)-5-(3-methoxycyclobutyl)oxy-4-(trifluoromethyl)pyridine.
Molecular Properties
| Compound Name | 2-(3,3-dimethylbut-1-ynyl)-5-(3-methoxycyclobutyl)oxy-4-(trifluoromethyl)pyridine |
| PubChem CID | 142386312 |
| Molecular Formula | C17H20F3NO2 |
| Molecular Weight | 327.35 g/mol |
| Exact Mass | 327.14 |
| IUPAC Name | 2-(3,3-dimethylbut-1-ynyl)-5-(3-methoxycyclobutyl)oxy-4-(trifluoromethyl)pyridine |
| SMILES | COC1CC(Oc2cnc(C#CC(C)(C)C)cc2C(F)(F)F)C1 |
| InChI | InChI=1S/C17H20F3NO2/c1-16(2,3)6-5-11-7-14(17(18,19)20)15(10-21-11)23-13-8-12(9-13)22-4/h7,10,12-13H,8-9H2,1-4H3 |
| InChIKey | NZYGGVIOFUNMHF-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.35 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(3,3-dimethylbut-1-ynyl)-5-(3-methoxycyclobutyl)oxy-4-(trifluoromethyl)pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,3-dimethylbut-1-ynyl)-5-(3-methoxycyclobutyl)oxy-4-(trifluoromethyl)pyridine?
The IUPAC name of 2-(3,3-dimethylbut-1-ynyl)-5-(3-methoxycyclobutyl)oxy-4-(trifluoromethyl)pyridine (CID 142386312) is 2-(3,3-dimethylbut-1-ynyl)-5-(3-methoxycyclobutyl)oxy-4-(trifluoromethyl)pyridine.
What is the SMILES notation for 2-(3,3-dimethylbut-1-ynyl)-5-(3-methoxycyclobutyl)oxy-4-(trifluoromethyl)pyridine?
The canonical SMILES for 2-(3,3-dimethylbut-1-ynyl)-5-(3-methoxycyclobutyl)oxy-4-(trifluoromethyl)pyridine is COC1CC(Oc2cnc(C#CC(C)(C)C)cc2C(F)(F)F)C1.
What is the InChIKey of 2-(3,3-dimethylbut-1-ynyl)-5-(3-methoxycyclobutyl)oxy-4-(trifluoromethyl)pyridine?
The InChIKey is NZYGGVIOFUNMHF-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H20F3NO2/c1-16(2,3)6-5-11-7-14(17(18,19)20)15(10-21-11)23-13-8-12(9-13)22-4/h7,10,12-13H,8-9H2,1-4H3.
What are the key properties of 2-(3,3-dimethylbut-1-ynyl)-5-(3-methoxycyclobutyl)oxy-4-(trifluoromethyl)pyridine?
2-(3,3-dimethylbut-1-ynyl)-5-(3-methoxycyclobutyl)oxy-4-(trifluoromethyl)pyridine has a molecular weight of 327.35 g/mol, XLogP of 4.05, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,3-dimethylbut-1-ynyl)-5-(3-methoxycyclobutyl)oxy-4-(trifluoromethyl)pyridine is sourced from PubChem (CID 142386312), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).