C33H69N3 — CID 142386375
(1R,4R)-2-tert-butyl-5-[2,4-dimethyl-4-[1-(2,3,3-trimethylpentan-2-yl)piperidin-4-yl]pentan-2-yl]-2,5-diazabicyclo[2.2.1]heptane;methane;propane (PubChem CID 142386375) has the molecular formula C33H69N3 and a molecular weight of 507.94 g/mol. Its IUPAC name is (1R,4R)-2-tert-butyl-5-[2,4-dimethyl-4-[1-(2,3,3-trimethylpentan-2-yl)piperidin-4-yl]pentan-2-yl]-2,5-diazabicyclo[2.2.1]heptane;methane;propane.
| Compound Name | (1R,4R)-2-tert-butyl-5-[2,4-dimethyl-4-[1-(2,3,3-trimethylpentan-2-yl)piperidin-4-yl]pentan-2-yl]-2,5-diazabicyclo[2.2.1]heptane;methane;propane |
|---|---|
| PubChem CID | 142386375 |
| Molecular Formula | C33H69N3 |
| Molecular Weight | 507.94 g/mol |
| Exact Mass | 507.55 |
| IUPAC Name | (1R,4R)-2-tert-butyl-5-[2,4-dimethyl-4-[1-(2,3,3-trimethylpentan-2-yl)piperidin-4-yl]pentan-2-yl]-2,5-diazabicyclo[2.2.1]heptane;methane;propane |
| SMILES | C.CCC.CCC(C)(C)C(C)(C)N1CCC(C(C)(C)CC(C)(C)N2C[C@H]3C[C@@H]2CN3C(C)(C)C)CC1 |
| InChI | InChI=1S/C29H57N3.C3H8.CH4/c1-13-27(7,8)29(11,12)30-16-14-22(15-17-30)26(5,6)21-28(9,10)32-20-23-18-24(32)19-31(23)25(2,3)4;1-3-2;/h22-24H,13-21H2,1-12H3;3H2,1-2H3;1H4/t23-,24-;;/m1../s1 |
| InChIKey | OZIAFXHJVMDKAN-NILKIKDOSA-N |
| XLogP | 8.72 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.94 |
| LogP ≤ 5 | 8.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |