About 9-butan-2-yl-N,N-dimethylpurin-2-amine
9-butan-2-yl-N,N-dimethylpurin-2-amine (PubChem CID 142386497) has the molecular formula C11H17N5
and a molecular weight of 219.29 g/mol. Its IUPAC name is 9-butan-2-yl-N,N-dimethylpurin-2-amine.
Molecular Properties
| Compound Name | 9-butan-2-yl-N,N-dimethylpurin-2-amine |
| PubChem CID | 142386497 |
| Molecular Formula | C11H17N5 |
| Molecular Weight | 219.29 g/mol |
| Exact Mass | 219.15 |
| IUPAC Name | 9-butan-2-yl-N,N-dimethylpurin-2-amine |
| SMILES | CCC(C)n1cnc2cnc(N(C)C)nc21 |
| InChI | InChI=1S/C11H17N5/c1-5-8(2)16-7-13-9-6-12-11(15(3)4)14-10(9)16/h6-8H,5H2,1-4H3 |
| InChIKey | JVWMLYXJYCIMBJ-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 46.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.29 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 9-butan-2-yl-N,N-dimethylpurin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-butan-2-yl-N,N-dimethylpurin-2-amine?
The IUPAC name of 9-butan-2-yl-N,N-dimethylpurin-2-amine (CID 142386497) is 9-butan-2-yl-N,N-dimethylpurin-2-amine.
What is the SMILES notation for 9-butan-2-yl-N,N-dimethylpurin-2-amine?
The canonical SMILES for 9-butan-2-yl-N,N-dimethylpurin-2-amine is CCC(C)n1cnc2cnc(N(C)C)nc21.
What is the InChIKey of 9-butan-2-yl-N,N-dimethylpurin-2-amine?
The InChIKey is JVWMLYXJYCIMBJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17N5/c1-5-8(2)16-7-13-9-6-12-11(15(3)4)14-10(9)16/h6-8H,5H2,1-4H3.
What are the key properties of 9-butan-2-yl-N,N-dimethylpurin-2-amine?
9-butan-2-yl-N,N-dimethylpurin-2-amine has a molecular weight of 219.29 g/mol, XLogP of 1.86, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 9-butan-2-yl-N,N-dimethylpurin-2-amine is sourced from PubChem (CID 142386497), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).