C12H17N3O3 — CID 142386891
methyl 2-amino-6-(4-hydroxypiperidin-1-yl)pyridine-3-carboxylate (PubChem CID 142386891) has the molecular formula C12H17N3O3 and a molecular weight of 251.29 g/mol. Its IUPAC name is methyl 2-amino-6-(4-hydroxypiperidin-1-yl)pyridine-3-carboxylate.
| Compound Name | methyl 2-amino-6-(4-hydroxypiperidin-1-yl)pyridine-3-carboxylate |
|---|---|
| PubChem CID | 142386891 |
| Molecular Formula | C12H17N3O3 |
| Molecular Weight | 251.29 g/mol |
| Exact Mass | 251.13 |
| IUPAC Name | methyl 2-amino-6-(4-hydroxypiperidin-1-yl)pyridine-3-carboxylate |
| SMILES | COC(=O)c1ccc(N2CCC(O)CC2)nc1N |
| InChI | InChI=1S/C12H17N3O3/c1-18-12(17)9-2-3-10(14-11(9)13)15-6-4-8(16)5-7-15/h2-3,8,16H,4-7H2,1H3,(H2,13,14) |
| InChIKey | UMPBNORDTLPWKG-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 88.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.29 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |