C9H17N3O — CID 142387019
1-[3-[methyl(methylaminomethyl)amino]azetidin-1-yl]prop-2-en-1-one (PubChem CID 142387019) has the molecular formula C9H17N3O and a molecular weight of 183.25 g/mol. Its IUPAC name is 1-[3-[methyl(methylaminomethyl)amino]azetidin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[3-[methyl(methylaminomethyl)amino]azetidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 142387019 |
| Molecular Formula | C9H17N3O |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.14 |
| IUPAC Name | 1-[3-[methyl(methylaminomethyl)amino]azetidin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CC(N(C)CNC)C1 |
| InChI | InChI=1S/C9H17N3O/c1-4-9(13)12-5-8(6-12)11(3)7-10-2/h4,8,10H,1,5-7H2,2-3H3 |
| InChIKey | LLILOBGCERMWSD-UHFFFAOYSA-N |
| XLogP | -0.51 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|