About 1-(2,2-difluoropropanimidoyl)piperazin-2-imine
1-(2,2-difluoropropanimidoyl)piperazin-2-imine (PubChem CID 142387115) has the molecular formula C7H12F2N4
and a molecular weight of 190.20 g/mol. Its IUPAC name is 1-(2,2-difluoropropanimidoyl)piperazin-2-imine.
Molecular Properties
| Compound Name | 1-(2,2-difluoropropanimidoyl)piperazin-2-imine |
| PubChem CID | 142387115 |
| Molecular Formula | C7H12F2N4 |
| Molecular Weight | 190.20 g/mol |
| Exact Mass | 190.10 |
| IUPAC Name | 1-(2,2-difluoropropanimidoyl)piperazin-2-imine |
| SMILES | [H]/N=C1\CNCCN1/C(=N/[H])C(C)(F)F |
| InChI | InChI=1S/C7H12F2N4/c1-7(8,9)6(11)13-3-2-12-4-5(13)10/h10-12H,2-4H2,1H3/b10-5+,11-6+ |
| InChIKey | LAMSRAYQPCKBHP-YOYBCKCWSA-N |
| XLogP | 0.50 |
| TPSA | 62.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.20 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 1-(2,2-difluoropropanimidoyl)piperazin-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,2-difluoropropanimidoyl)piperazin-2-imine?
The IUPAC name of 1-(2,2-difluoropropanimidoyl)piperazin-2-imine (CID 142387115) is 1-(2,2-difluoropropanimidoyl)piperazin-2-imine.
What is the SMILES notation for 1-(2,2-difluoropropanimidoyl)piperazin-2-imine?
The canonical SMILES for 1-(2,2-difluoropropanimidoyl)piperazin-2-imine is [H]/N=C1\CNCCN1/C(=N/[H])C(C)(F)F.
What is the InChIKey of 1-(2,2-difluoropropanimidoyl)piperazin-2-imine?
The InChIKey is LAMSRAYQPCKBHP-YOYBCKCWSA-N. The full InChI is InChI=1S/C7H12F2N4/c1-7(8,9)6(11)13-3-2-12-4-5(13)10/h10-12H,2-4H2,1H3/b10-5+,11-6+.
What are the key properties of 1-(2,2-difluoropropanimidoyl)piperazin-2-imine?
1-(2,2-difluoropropanimidoyl)piperazin-2-imine has a molecular weight of 190.20 g/mol, XLogP of 0.50, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,2-difluoropropanimidoyl)piperazin-2-imine is sourced from PubChem (CID 142387115), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).