About methyl 2-amino-3-(4-chloro-3-propoxyphenyl)-3,3-difluoropropanoate
methyl 2-amino-3-(4-chloro-3-propoxyphenyl)-3,3-difluoropropanoate (PubChem CID 142387222) has the molecular formula C13H16ClF2NO3
and a molecular weight of 307.72 g/mol. Its IUPAC name is methyl 2-amino-3-(4-chloro-3-propoxyphenyl)-3,3-difluoropropanoate.
Molecular Properties
| Compound Name | methyl 2-amino-3-(4-chloro-3-propoxyphenyl)-3,3-difluoropropanoate |
| PubChem CID | 142387222 |
| Molecular Formula | C13H16ClF2NO3 |
| Molecular Weight | 307.72 g/mol |
| Exact Mass | 307.08 |
| IUPAC Name | methyl 2-amino-3-(4-chloro-3-propoxyphenyl)-3,3-difluoropropanoate |
| SMILES | CCCOc1cc(C(F)(F)C(N)C(=O)OC)ccc1Cl |
| InChI | InChI=1S/C13H16ClF2NO3/c1-3-6-20-10-7-8(4-5-9(10)14)13(15,16)11(17)12(18)19-2/h4-5,7,11H,3,6,17H2,1-2H3 |
| InChIKey | PCHPRLJKSRVRJY-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.72 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 2-amino-3-(4-chloro-3-propoxyphenyl)-3,3-difluoropropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-amino-3-(4-chloro-3-propoxyphenyl)-3,3-difluoropropanoate?
The IUPAC name of methyl 2-amino-3-(4-chloro-3-propoxyphenyl)-3,3-difluoropropanoate (CID 142387222) is methyl 2-amino-3-(4-chloro-3-propoxyphenyl)-3,3-difluoropropanoate.
What is the SMILES notation for methyl 2-amino-3-(4-chloro-3-propoxyphenyl)-3,3-difluoropropanoate?
The canonical SMILES for methyl 2-amino-3-(4-chloro-3-propoxyphenyl)-3,3-difluoropropanoate is CCCOc1cc(C(F)(F)C(N)C(=O)OC)ccc1Cl.
What is the InChIKey of methyl 2-amino-3-(4-chloro-3-propoxyphenyl)-3,3-difluoropropanoate?
The InChIKey is PCHPRLJKSRVRJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16ClF2NO3/c1-3-6-20-10-7-8(4-5-9(10)14)13(15,16)11(17)12(18)19-2/h4-5,7,11H,3,6,17H2,1-2H3.
What are the key properties of methyl 2-amino-3-(4-chloro-3-propoxyphenyl)-3,3-difluoropropanoate?
methyl 2-amino-3-(4-chloro-3-propoxyphenyl)-3,3-difluoropropanoate has a molecular weight of 307.72 g/mol, XLogP of 2.72, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-amino-3-(4-chloro-3-propoxyphenyl)-3,3-difluoropropanoate is sourced from PubChem (CID 142387222), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).