C19H29F2N3O3 — CID 142387415
tert-butyl N-[1-[(4E)-2-amino-4-ethenyl-3,3-difluorohepta-4,6-dienoyl]piperidin-4-yl]carbamate (PubChem CID 142387415) has the molecular formula C19H29F2N3O3 and a molecular weight of 385.46 g/mol. Its IUPAC name is tert-butyl N-[1-[(4E)-2-amino-4-ethenyl-3,3-difluorohepta-4,6-dienoyl]piperidin-4-yl]carbamate.
| Compound Name | tert-butyl N-[1-[(4E)-2-amino-4-ethenyl-3,3-difluorohepta-4,6-dienoyl]piperidin-4-yl]carbamate |
|---|---|
| PubChem CID | 142387415 |
| Molecular Formula | C19H29F2N3O3 |
| Molecular Weight | 385.46 g/mol |
| Exact Mass | 385.22 |
| IUPAC Name | tert-butyl N-[1-[(4E)-2-amino-4-ethenyl-3,3-difluorohepta-4,6-dienoyl]piperidin-4-yl]carbamate |
| SMILES | C=C/C=C(\C=C)C(F)(F)C(N)C(=O)N1CCC(NC(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C19H29F2N3O3/c1-6-8-13(7-2)19(20,21)15(22)16(25)24-11-9-14(10-12-24)23-17(26)27-18(3,4)5/h6-8,14-15H,1-2,9-12,22H2,3-5H3,(H,23,26)/b13-8+ |
| InChIKey | ZGAFNFWRYXOTDE-MDWZMJQESA-N |
| XLogP | 2.76 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.46 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|