About (2E,3E)-2-ethylidene-4-(hydroxymethyl)hexa-3,5-dienenitrile;propane
(2E,3E)-2-ethylidene-4-(hydroxymethyl)hexa-3,5-dienenitrile;propane (PubChem CID 142387782) has the molecular formula C12H19NO
and a molecular weight of 193.29 g/mol. Its IUPAC name is (2E,3E)-2-ethylidene-4-(hydroxymethyl)hexa-3,5-dienenitrile;propane.
Molecular Properties
| Compound Name | (2E,3E)-2-ethylidene-4-(hydroxymethyl)hexa-3,5-dienenitrile;propane |
| PubChem CID | 142387782 |
| Molecular Formula | C12H19NO |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.15 |
| IUPAC Name | (2E,3E)-2-ethylidene-4-(hydroxymethyl)hexa-3,5-dienenitrile;propane |
| SMILES | C=C/C(=C\C(C#N)=C/C)CO.CCC |
| InChI | InChI=1S/C9H11NO.C3H8/c1-3-8(6-10)5-9(4-2)7-11;1-3-2/h3-5,11H,2,7H2,1H3;3H2,1-2H3/b8-3+,9-5+; |
| InChIKey | AVOVDTSSZJYIGI-DASMDOOLSA-N |
| XLogP | 2.98 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (2E,3E)-2-ethylidene-4-(hydroxymethyl)hexa-3,5-dienenitrile;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E,3E)-2-ethylidene-4-(hydroxymethyl)hexa-3,5-dienenitrile;propane?
The IUPAC name of (2E,3E)-2-ethylidene-4-(hydroxymethyl)hexa-3,5-dienenitrile;propane (CID 142387782) is (2E,3E)-2-ethylidene-4-(hydroxymethyl)hexa-3,5-dienenitrile;propane.
What is the SMILES notation for (2E,3E)-2-ethylidene-4-(hydroxymethyl)hexa-3,5-dienenitrile;propane?
The canonical SMILES for (2E,3E)-2-ethylidene-4-(hydroxymethyl)hexa-3,5-dienenitrile;propane is C=C/C(=C\C(C#N)=C/C)CO.CCC.
What is the InChIKey of (2E,3E)-2-ethylidene-4-(hydroxymethyl)hexa-3,5-dienenitrile;propane?
The InChIKey is AVOVDTSSZJYIGI-DASMDOOLSA-N. The full InChI is InChI=1S/C9H11NO.C3H8/c1-3-8(6-10)5-9(4-2)7-11;1-3-2/h3-5,11H,2,7H2,1H3;3H2,1-2H3/b8-3+,9-5+;.
What are the key properties of (2E,3E)-2-ethylidene-4-(hydroxymethyl)hexa-3,5-dienenitrile;propane?
(2E,3E)-2-ethylidene-4-(hydroxymethyl)hexa-3,5-dienenitrile;propane has a molecular weight of 193.29 g/mol, XLogP of 2.98, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2E,3E)-2-ethylidene-4-(hydroxymethyl)hexa-3,5-dienenitrile;propane is sourced from PubChem (CID 142387782), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).