About 2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]propan-2-yl 2-methylpropanoate
2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]propan-2-yl 2-methylpropanoate (PubChem CID 14238829) has the molecular formula C12H22O4
and a molecular weight of 230.30 g/mol. Its IUPAC name is 2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]propan-2-yl 2-methylpropanoate.
Molecular Properties
| Compound Name | 2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]propan-2-yl 2-methylpropanoate |
| PubChem CID | 14238829 |
| Molecular Formula | C12H22O4 |
| Molecular Weight | 230.30 g/mol |
| Exact Mass | 230.15 |
| IUPAC Name | 2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]propan-2-yl 2-methylpropanoate |
| SMILES | CC(C)C(=O)OC(C)(C)[C@@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C12H22O4/c1-8(2)10(13)16-11(3,4)9-7-14-12(5,6)15-9/h8-9H,7H2,1-6H3/t9-/m0/s1 |
| InChIKey | UVRMKIHWXWMMEV-VIFPVBQESA-N |
| XLogP | 2.12 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.30 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]propan-2-yl 2-methylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]propan-2-yl 2-methylpropanoate?
The IUPAC name of 2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]propan-2-yl 2-methylpropanoate (CID 14238829) is 2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]propan-2-yl 2-methylpropanoate.
What is the SMILES notation for 2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]propan-2-yl 2-methylpropanoate?
The canonical SMILES for 2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]propan-2-yl 2-methylpropanoate is CC(C)C(=O)OC(C)(C)[C@@H]1COC(C)(C)O1.
What is the InChIKey of 2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]propan-2-yl 2-methylpropanoate?
The InChIKey is UVRMKIHWXWMMEV-VIFPVBQESA-N. The full InChI is InChI=1S/C12H22O4/c1-8(2)10(13)16-11(3,4)9-7-14-12(5,6)15-9/h8-9H,7H2,1-6H3/t9-/m0/s1.
What are the key properties of 2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]propan-2-yl 2-methylpropanoate?
2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]propan-2-yl 2-methylpropanoate has a molecular weight of 230.30 g/mol, XLogP of 2.12, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]propan-2-yl 2-methylpropanoate is sourced from PubChem (CID 14238829), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).