About 1-[(3E)-4-propan-2-ylhexa-1,3,5-trien-3-yl]pyrrolidine
1-[(3E)-4-propan-2-ylhexa-1,3,5-trien-3-yl]pyrrolidine (PubChem CID 142388433) has the molecular formula C13H21N
and a molecular weight of 191.32 g/mol. Its IUPAC name is 1-[(3E)-4-propan-2-ylhexa-1,3,5-trien-3-yl]pyrrolidine.
Molecular Properties
| Compound Name | 1-[(3E)-4-propan-2-ylhexa-1,3,5-trien-3-yl]pyrrolidine |
| PubChem CID | 142388433 |
| Molecular Formula | C13H21N |
| Molecular Weight | 191.32 g/mol |
| Exact Mass | 191.17 |
| IUPAC Name | 1-[(3E)-4-propan-2-ylhexa-1,3,5-trien-3-yl]pyrrolidine |
| SMILES | C=C/C(=C(\C=C)N1CCCC1)C(C)C |
| InChI | InChI=1S/C13H21N/c1-5-12(11(3)4)13(6-2)14-9-7-8-10-14/h5-6,11H,1-2,7-10H2,3-4H3/b13-12- |
| InChIKey | LXAHLIPYUIEUOO-SEYXRHQNSA-N |
| XLogP | 3.36 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.32 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 1-[(3E)-4-propan-2-ylhexa-1,3,5-trien-3-yl]pyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(3E)-4-propan-2-ylhexa-1,3,5-trien-3-yl]pyrrolidine?
The IUPAC name of 1-[(3E)-4-propan-2-ylhexa-1,3,5-trien-3-yl]pyrrolidine (CID 142388433) is 1-[(3E)-4-propan-2-ylhexa-1,3,5-trien-3-yl]pyrrolidine.
What is the SMILES notation for 1-[(3E)-4-propan-2-ylhexa-1,3,5-trien-3-yl]pyrrolidine?
The canonical SMILES for 1-[(3E)-4-propan-2-ylhexa-1,3,5-trien-3-yl]pyrrolidine is C=C/C(=C(\C=C)N1CCCC1)C(C)C.
What is the InChIKey of 1-[(3E)-4-propan-2-ylhexa-1,3,5-trien-3-yl]pyrrolidine?
The InChIKey is LXAHLIPYUIEUOO-SEYXRHQNSA-N. The full InChI is InChI=1S/C13H21N/c1-5-12(11(3)4)13(6-2)14-9-7-8-10-14/h5-6,11H,1-2,7-10H2,3-4H3/b13-12-.
What are the key properties of 1-[(3E)-4-propan-2-ylhexa-1,3,5-trien-3-yl]pyrrolidine?
1-[(3E)-4-propan-2-ylhexa-1,3,5-trien-3-yl]pyrrolidine has a molecular weight of 191.32 g/mol, XLogP of 3.36, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(3E)-4-propan-2-ylhexa-1,3,5-trien-3-yl]pyrrolidine is sourced from PubChem (CID 142388433), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).