About 3,8-dimethyl-1,7-naphthyridine;ethane
3,8-dimethyl-1,7-naphthyridine;ethane (PubChem CID 142388787) has the molecular formula C12H16N2
and a molecular weight of 188.27 g/mol. Its IUPAC name is 3,8-dimethyl-1,7-naphthyridine;ethane.
Molecular Properties
| Compound Name | 3,8-dimethyl-1,7-naphthyridine;ethane |
| PubChem CID | 142388787 |
| Molecular Formula | C12H16N2 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.13 |
| IUPAC Name | 3,8-dimethyl-1,7-naphthyridine;ethane |
| SMILES | CC.Cc1cnc2c(C)nccc2c1 |
| InChI | InChI=1S/C10H10N2.C2H6/c1-7-5-9-3-4-11-8(2)10(9)12-6-7;1-2/h3-6H,1-2H3;1-2H3 |
| InChIKey | NAGNZBYPNBGFQT-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3,8-dimethyl-1,7-naphthyridine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,8-dimethyl-1,7-naphthyridine;ethane?
The IUPAC name of 3,8-dimethyl-1,7-naphthyridine;ethane (CID 142388787) is 3,8-dimethyl-1,7-naphthyridine;ethane.
What is the SMILES notation for 3,8-dimethyl-1,7-naphthyridine;ethane?
The canonical SMILES for 3,8-dimethyl-1,7-naphthyridine;ethane is CC.Cc1cnc2c(C)nccc2c1.
What is the InChIKey of 3,8-dimethyl-1,7-naphthyridine;ethane?
The InChIKey is NAGNZBYPNBGFQT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N2.C2H6/c1-7-5-9-3-4-11-8(2)10(9)12-6-7;1-2/h3-6H,1-2H3;1-2H3.
What are the key properties of 3,8-dimethyl-1,7-naphthyridine;ethane?
3,8-dimethyl-1,7-naphthyridine;ethane has a molecular weight of 188.27 g/mol, XLogP of 3.27, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,8-dimethyl-1,7-naphthyridine;ethane is sourced from PubChem (CID 142388787), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).