About ethane;N-(4-ethenyl-1,2-dihydropyridin-3-yl)ethanimine
ethane;N-(4-ethenyl-1,2-dihydropyridin-3-yl)ethanimine (PubChem CID 142388805) has the molecular formula C13H24N2
and a molecular weight of 208.35 g/mol. Its IUPAC name is ethane;N-(4-ethenyl-1,2-dihydropyridin-3-yl)ethanimine.
Molecular Properties
| Compound Name | ethane;N-(4-ethenyl-1,2-dihydropyridin-3-yl)ethanimine |
| PubChem CID | 142388805 |
| Molecular Formula | C13H24N2 |
| Molecular Weight | 208.35 g/mol |
| Exact Mass | 208.19 |
| IUPAC Name | ethane;N-(4-ethenyl-1,2-dihydropyridin-3-yl)ethanimine |
| SMILES | C=CC1=C(/N=C/C)CNC=C1.CC.CC |
| InChI | InChI=1S/C9H12N2.2C2H6/c1-3-8-5-6-10-7-9(8)11-4-2;2*1-2/h3-6,10H,1,7H2,2H3;2*1-2H3/b11-4+;; |
| InChIKey | JMGRIXKKVRGOSE-QKBHCULISA-N |
| XLogP | 3.69 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.35 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze ethane;N-(4-ethenyl-1,2-dihydropyridin-3-yl)ethanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;N-(4-ethenyl-1,2-dihydropyridin-3-yl)ethanimine?
The IUPAC name of ethane;N-(4-ethenyl-1,2-dihydropyridin-3-yl)ethanimine (CID 142388805) is ethane;N-(4-ethenyl-1,2-dihydropyridin-3-yl)ethanimine.
What is the SMILES notation for ethane;N-(4-ethenyl-1,2-dihydropyridin-3-yl)ethanimine?
The canonical SMILES for ethane;N-(4-ethenyl-1,2-dihydropyridin-3-yl)ethanimine is C=CC1=C(/N=C/C)CNC=C1.CC.CC.
What is the InChIKey of ethane;N-(4-ethenyl-1,2-dihydropyridin-3-yl)ethanimine?
The InChIKey is JMGRIXKKVRGOSE-QKBHCULISA-N. The full InChI is InChI=1S/C9H12N2.2C2H6/c1-3-8-5-6-10-7-9(8)11-4-2;2*1-2/h3-6,10H,1,7H2,2H3;2*1-2H3/b11-4+;;.
What are the key properties of ethane;N-(4-ethenyl-1,2-dihydropyridin-3-yl)ethanimine?
ethane;N-(4-ethenyl-1,2-dihydropyridin-3-yl)ethanimine has a molecular weight of 208.35 g/mol, XLogP of 3.69, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;N-(4-ethenyl-1,2-dihydropyridin-3-yl)ethanimine is sourced from PubChem (CID 142388805), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).