C36H37N5O4 — CID 142388879
ethane;5-formyl-2-[2-methyl-3-[2-methyl-3-[5-[(2S)-1-methylpyrrolidine-2-carbonyl]-2,3,4,6-tetrahydropyrrolo[3,4-d][1,3]oxazol-2-yl]phenyl]phenyl]-1,3-benzoxazole-7-carbonitrile (PubChem CID 142388879) has the molecular formula C36H37N5O4 and a molecular weight of 603.72 g/mol. Its IUPAC name is ethane;5-formyl-2-[2-methyl-3-[2-methyl-3-[5-[(2S)-1-methylpyrrolidine-2-carbonyl]-2,3,4,6-tetrahydropyrrolo[3,4-d][1,3]oxazol-2-yl]phenyl]phenyl]-1,3-benzoxazole-7-carbonitrile.
| Compound Name | ethane;5-formyl-2-[2-methyl-3-[2-methyl-3-[5-[(2S)-1-methylpyrrolidine-2-carbonyl]-2,3,4,6-tetrahydropyrrolo[3,4-d][1,3]oxazol-2-yl]phenyl]phenyl]-1,3-benzoxazole-7-carbonitrile |
|---|---|
| PubChem CID | 142388879 |
| Molecular Formula | C36H37N5O4 |
| Molecular Weight | 603.72 g/mol |
| Exact Mass | 603.28 |
| IUPAC Name | ethane;5-formyl-2-[2-methyl-3-[2-methyl-3-[5-[(2S)-1-methylpyrrolidine-2-carbonyl]-2,3,4,6-tetrahydropyrrolo[3,4-d][1,3]oxazol-2-yl]phenyl]phenyl]-1,3-benzoxazole-7-carbonitrile |
| SMILES | CC.Cc1c(-c2nc3cc(C=O)cc(C#N)c3o2)cccc1-c1cccc(C2NC3=C(CN(C(=O)[C@@H]4CCCN4C)C3)O2)c1C |
| InChI | InChI=1S/C34H31N5O4.C2H6/c1-19-23(24-8-5-10-26(20(24)2)33-36-27-14-21(18-40)13-22(15-35)31(27)43-33)7-4-9-25(19)32-37-28-16-39(17-30(28)42-32)34(41)29-11-6-12-38(29)3;1-2/h4-5,7-10,13-14,18,29,32,37H,6,11-12,16-17H2,1-3H3;1-2H3/t29-,32?;/m0./s1 |
| InChIKey | ZTUZOAFTQMQKIL-LUYNFPSJSA-N |
| XLogP | 6.26 |
| TPSA | 111.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.72 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|