About 7-methyl-3,8-dihydropyrrolo[3,4-b]azepin-6-one
7-methyl-3,8-dihydropyrrolo[3,4-b]azepin-6-one (PubChem CID 142389285) has the molecular formula C9H10N2O
and a molecular weight of 162.19 g/mol. Its IUPAC name is 7-methyl-3,8-dihydropyrrolo[3,4-b]azepin-6-one.
Molecular Properties
| Compound Name | 7-methyl-3,8-dihydropyrrolo[3,4-b]azepin-6-one |
| PubChem CID | 142389285 |
| Molecular Formula | C9H10N2O |
| Molecular Weight | 162.19 g/mol |
| Exact Mass | 162.08 |
| IUPAC Name | 7-methyl-3,8-dihydropyrrolo[3,4-b]azepin-6-one |
| SMILES | CN1CC2=C(C=CCC=N2)C1=O |
| InChI | InChI=1S/C9H10N2O/c1-11-6-8-7(9(11)12)4-2-3-5-10-8/h2,4-5H,3,6H2,1H3 |
| InChIKey | QQPKRHBYAMDYCU-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.19 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7-methyl-3,8-dihydropyrrolo[3,4-b]azepin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methyl-3,8-dihydropyrrolo[3,4-b]azepin-6-one?
The IUPAC name of 7-methyl-3,8-dihydropyrrolo[3,4-b]azepin-6-one (CID 142389285) is 7-methyl-3,8-dihydropyrrolo[3,4-b]azepin-6-one.
What is the SMILES notation for 7-methyl-3,8-dihydropyrrolo[3,4-b]azepin-6-one?
The canonical SMILES for 7-methyl-3,8-dihydropyrrolo[3,4-b]azepin-6-one is CN1CC2=C(C=CCC=N2)C1=O.
What is the InChIKey of 7-methyl-3,8-dihydropyrrolo[3,4-b]azepin-6-one?
The InChIKey is QQPKRHBYAMDYCU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N2O/c1-11-6-8-7(9(11)12)4-2-3-5-10-8/h2,4-5H,3,6H2,1H3.
What are the key properties of 7-methyl-3,8-dihydropyrrolo[3,4-b]azepin-6-one?
7-methyl-3,8-dihydropyrrolo[3,4-b]azepin-6-one has a molecular weight of 162.19 g/mol, XLogP of 0.74, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methyl-3,8-dihydropyrrolo[3,4-b]azepin-6-one is sourced from PubChem (CID 142389285), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).