C29H38BNO7 — CID 142389521
methyl 3-methyl-2-[3-oxo-5-[2-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methoxy]ethoxy]-1H-isoindol-2-yl]butanoate (PubChem CID 142389521) has the molecular formula C29H38BNO7 and a molecular weight of 523.44 g/mol. Its IUPAC name is methyl 3-methyl-2-[3-oxo-5-[2-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methoxy]ethoxy]-1H-isoindol-2-yl]butanoate.
| Compound Name | methyl 3-methyl-2-[3-oxo-5-[2-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methoxy]ethoxy]-1H-isoindol-2-yl]butanoate |
|---|---|
| PubChem CID | 142389521 |
| Molecular Formula | C29H38BNO7 |
| Molecular Weight | 523.44 g/mol |
| Exact Mass | 523.27 |
| IUPAC Name | methyl 3-methyl-2-[3-oxo-5-[2-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methoxy]ethoxy]-1H-isoindol-2-yl]butanoate |
| SMILES | COC(=O)C(C(C)C)N1Cc2ccc(OCCOCc3ccc(B4OC(C)(C)C(C)(C)O4)cc3)cc2C1=O |
| InChI | InChI=1S/C29H38BNO7/c1-19(2)25(27(33)34-7)31-17-21-10-13-23(16-24(21)26(31)32)36-15-14-35-18-20-8-11-22(12-9-20)30-37-28(3,4)29(5,6)38-30/h8-13,16,19,25H,14-15,17-18H2,1-7H3 |
| InChIKey | RFTUOJRPHYSPQT-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 83.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.44 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|