About [5-[(2S)-2-methylcyclopropyl]-1,2-oxazol-3-yl]methanol
[5-[(2S)-2-methylcyclopropyl]-1,2-oxazol-3-yl]methanol (PubChem CID 142389814) has the molecular formula C8H11NO2
and a molecular weight of 153.18 g/mol. Its IUPAC name is [5-[(2S)-2-methylcyclopropyl]-1,2-oxazol-3-yl]methanol.
Molecular Properties
| Compound Name | [5-[(2S)-2-methylcyclopropyl]-1,2-oxazol-3-yl]methanol |
| PubChem CID | 142389814 |
| Molecular Formula | C8H11NO2 |
| Molecular Weight | 153.18 g/mol |
| Exact Mass | 153.08 |
| IUPAC Name | [5-[(2S)-2-methylcyclopropyl]-1,2-oxazol-3-yl]methanol |
| SMILES | C[C@H]1CC1c1cc(CO)no1 |
| InChI | InChI=1S/C8H11NO2/c1-5-2-7(5)8-3-6(4-10)9-11-8/h3,5,7,10H,2,4H2,1H3/t5-,7?/m0/s1 |
| InChIKey | RWYRQFYVIQUXTG-DSEUIKHZSA-N |
| XLogP | 1.29 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.18 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [5-[(2S)-2-methylcyclopropyl]-1,2-oxazol-3-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-[(2S)-2-methylcyclopropyl]-1,2-oxazol-3-yl]methanol?
The IUPAC name of [5-[(2S)-2-methylcyclopropyl]-1,2-oxazol-3-yl]methanol (CID 142389814) is [5-[(2S)-2-methylcyclopropyl]-1,2-oxazol-3-yl]methanol.
What is the SMILES notation for [5-[(2S)-2-methylcyclopropyl]-1,2-oxazol-3-yl]methanol?
The canonical SMILES for [5-[(2S)-2-methylcyclopropyl]-1,2-oxazol-3-yl]methanol is C[C@H]1CC1c1cc(CO)no1.
What is the InChIKey of [5-[(2S)-2-methylcyclopropyl]-1,2-oxazol-3-yl]methanol?
The InChIKey is RWYRQFYVIQUXTG-DSEUIKHZSA-N. The full InChI is InChI=1S/C8H11NO2/c1-5-2-7(5)8-3-6(4-10)9-11-8/h3,5,7,10H,2,4H2,1H3/t5-,7?/m0/s1.
What are the key properties of [5-[(2S)-2-methylcyclopropyl]-1,2-oxazol-3-yl]methanol?
[5-[(2S)-2-methylcyclopropyl]-1,2-oxazol-3-yl]methanol has a molecular weight of 153.18 g/mol, XLogP of 1.29, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [5-[(2S)-2-methylcyclopropyl]-1,2-oxazol-3-yl]methanol is sourced from PubChem (CID 142389814), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).