About ethane;4-[(1E)-2-fluorobuta-1,3-dienyl]-1,3-dimethyl-2H-pyrrol-5-one
ethane;4-[(1E)-2-fluorobuta-1,3-dienyl]-1,3-dimethyl-2H-pyrrol-5-one (PubChem CID 142390330) has the molecular formula C12H18FNO
and a molecular weight of 211.28 g/mol. Its IUPAC name is ethane;4-[(1E)-2-fluorobuta-1,3-dienyl]-1,3-dimethyl-2H-pyrrol-5-one.
Molecular Properties
| Compound Name | ethane;4-[(1E)-2-fluorobuta-1,3-dienyl]-1,3-dimethyl-2H-pyrrol-5-one |
| PubChem CID | 142390330 |
| Molecular Formula | C12H18FNO |
| Molecular Weight | 211.28 g/mol |
| Exact Mass | 211.14 |
| IUPAC Name | ethane;4-[(1E)-2-fluorobuta-1,3-dienyl]-1,3-dimethyl-2H-pyrrol-5-one |
| SMILES | C=C/C(F)=C\C1=C(C)CN(C)C1=O.CC |
| InChI | InChI=1S/C10H12FNO.C2H6/c1-4-8(11)5-9-7(2)6-12(3)10(9)13;1-2/h4-5H,1,6H2,2-3H3;1-2H3/b8-5+; |
| InChIKey | HVIHZVGYKUTTCO-HAAWTFQLSA-N |
| XLogP | 2.84 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.28 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze ethane;4-[(1E)-2-fluorobuta-1,3-dienyl]-1,3-dimethyl-2H-pyrrol-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;4-[(1E)-2-fluorobuta-1,3-dienyl]-1,3-dimethyl-2H-pyrrol-5-one?
The IUPAC name of ethane;4-[(1E)-2-fluorobuta-1,3-dienyl]-1,3-dimethyl-2H-pyrrol-5-one (CID 142390330) is ethane;4-[(1E)-2-fluorobuta-1,3-dienyl]-1,3-dimethyl-2H-pyrrol-5-one.
What is the SMILES notation for ethane;4-[(1E)-2-fluorobuta-1,3-dienyl]-1,3-dimethyl-2H-pyrrol-5-one?
The canonical SMILES for ethane;4-[(1E)-2-fluorobuta-1,3-dienyl]-1,3-dimethyl-2H-pyrrol-5-one is C=C/C(F)=C\C1=C(C)CN(C)C1=O.CC.
What is the InChIKey of ethane;4-[(1E)-2-fluorobuta-1,3-dienyl]-1,3-dimethyl-2H-pyrrol-5-one?
The InChIKey is HVIHZVGYKUTTCO-HAAWTFQLSA-N. The full InChI is InChI=1S/C10H12FNO.C2H6/c1-4-8(11)5-9-7(2)6-12(3)10(9)13;1-2/h4-5H,1,6H2,2-3H3;1-2H3/b8-5+;.
What are the key properties of ethane;4-[(1E)-2-fluorobuta-1,3-dienyl]-1,3-dimethyl-2H-pyrrol-5-one?
ethane;4-[(1E)-2-fluorobuta-1,3-dienyl]-1,3-dimethyl-2H-pyrrol-5-one has a molecular weight of 211.28 g/mol, XLogP of 2.84, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;4-[(1E)-2-fluorobuta-1,3-dienyl]-1,3-dimethyl-2H-pyrrol-5-one is sourced from PubChem (CID 142390330), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).