About 3-methyl-2,6-dimethylidenepiperidine
3-methyl-2,6-dimethylidenepiperidine (PubChem CID 142390348) has the molecular formula C8H13N
and a molecular weight of 123.20 g/mol. Its IUPAC name is 3-methyl-2,6-dimethylidenepiperidine.
Molecular Properties
| Compound Name | 3-methyl-2,6-dimethylidenepiperidine |
| PubChem CID | 142390348 |
| Molecular Formula | C8H13N |
| Molecular Weight | 123.20 g/mol |
| Exact Mass | 123.10 |
| IUPAC Name | 3-methyl-2,6-dimethylidenepiperidine |
| SMILES | C=C1CCC(C)C(=C)N1 |
| InChI | InChI=1S/C8H13N/c1-6-4-5-7(2)9-8(6)3/h6,9H,2-5H2,1H3 |
| InChIKey | FEPFNQRUWLWIIJ-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 123.20 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-methyl-2,6-dimethylidenepiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-2,6-dimethylidenepiperidine?
The IUPAC name of 3-methyl-2,6-dimethylidenepiperidine (CID 142390348) is 3-methyl-2,6-dimethylidenepiperidine.
What is the SMILES notation for 3-methyl-2,6-dimethylidenepiperidine?
The canonical SMILES for 3-methyl-2,6-dimethylidenepiperidine is C=C1CCC(C)C(=C)N1.
What is the InChIKey of 3-methyl-2,6-dimethylidenepiperidine?
The InChIKey is FEPFNQRUWLWIIJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13N/c1-6-4-5-7(2)9-8(6)3/h6,9H,2-5H2,1H3.
What are the key properties of 3-methyl-2,6-dimethylidenepiperidine?
3-methyl-2,6-dimethylidenepiperidine has a molecular weight of 123.20 g/mol, XLogP of 2.03, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-2,6-dimethylidenepiperidine is sourced from PubChem (CID 142390348), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).