About ethane;1-ethyl-4-[3-[(5-methyl-2-pyridinyl)oxy]propyl]piperazine;methanol
ethane;1-ethyl-4-[3-[(5-methyl-2-pyridinyl)oxy]propyl]piperazine;methanol (PubChem CID 142390979) has the molecular formula C18H35N3O2
and a molecular weight of 325.50 g/mol. Its IUPAC name is ethane;1-ethyl-4-[3-[(5-methyl-2-pyridinyl)oxy]propyl]piperazine;methanol.
Molecular Properties
| Compound Name | ethane;1-ethyl-4-[3-[(5-methyl-2-pyridinyl)oxy]propyl]piperazine;methanol |
| PubChem CID | 142390979 |
| Molecular Formula | C18H35N3O2 |
| Molecular Weight | 325.50 g/mol |
| Exact Mass | 325.27 |
| IUPAC Name | ethane;1-ethyl-4-[3-[(5-methyl-2-pyridinyl)oxy]propyl]piperazine;methanol |
| SMILES | CC.CCN1CCN(CCCOc2ccc(C)cn2)CC1.CO |
| InChI | InChI=1S/C15H25N3O.C2H6.CH4O/c1-3-17-8-10-18(11-9-17)7-4-12-19-15-6-5-14(2)13-16-15;2*1-2/h5-6,13H,3-4,7-12H2,1-2H3;1-2H3;2H,1H3 |
| InChIKey | SFOPYPZTNFGVPS-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 48.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.50 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze ethane;1-ethyl-4-[3-[(5-methyl-2-pyridinyl)oxy]propyl]piperazine;methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-ethyl-4-[3-[(5-methyl-2-pyridinyl)oxy]propyl]piperazine;methanol?
The IUPAC name of ethane;1-ethyl-4-[3-[(5-methyl-2-pyridinyl)oxy]propyl]piperazine;methanol (CID 142390979) is ethane;1-ethyl-4-[3-[(5-methyl-2-pyridinyl)oxy]propyl]piperazine;methanol.
What is the SMILES notation for ethane;1-ethyl-4-[3-[(5-methyl-2-pyridinyl)oxy]propyl]piperazine;methanol?
The canonical SMILES for ethane;1-ethyl-4-[3-[(5-methyl-2-pyridinyl)oxy]propyl]piperazine;methanol is CC.CCN1CCN(CCCOc2ccc(C)cn2)CC1.CO.
What is the InChIKey of ethane;1-ethyl-4-[3-[(5-methyl-2-pyridinyl)oxy]propyl]piperazine;methanol?
The InChIKey is SFOPYPZTNFGVPS-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H25N3O.C2H6.CH4O/c1-3-17-8-10-18(11-9-17)7-4-12-19-15-6-5-14(2)13-16-15;2*1-2/h5-6,13H,3-4,7-12H2,1-2H3;1-2H3;2H,1H3.
What are the key properties of ethane;1-ethyl-4-[3-[(5-methyl-2-pyridinyl)oxy]propyl]piperazine;methanol?
ethane;1-ethyl-4-[3-[(5-methyl-2-pyridinyl)oxy]propyl]piperazine;methanol has a molecular weight of 325.50 g/mol, XLogP of 2.43, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-ethyl-4-[3-[(5-methyl-2-pyridinyl)oxy]propyl]piperazine;methanol is sourced from PubChem (CID 142390979), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).