C18H38N2O3 — CID 142391107
ethane;N-methyl-5-[3-(2-piperidin-1-ylethoxy)propoxy]pentanamide (PubChem CID 142391107) has the molecular formula C18H38N2O3 and a molecular weight of 330.51 g/mol. Its IUPAC name is ethane;N-methyl-5-[3-(2-piperidin-1-ylethoxy)propoxy]pentanamide.
| Compound Name | ethane;N-methyl-5-[3-(2-piperidin-1-ylethoxy)propoxy]pentanamide |
|---|---|
| PubChem CID | 142391107 |
| Molecular Formula | C18H38N2O3 |
| Molecular Weight | 330.51 g/mol |
| Exact Mass | 330.29 |
| IUPAC Name | ethane;N-methyl-5-[3-(2-piperidin-1-ylethoxy)propoxy]pentanamide |
| SMILES | CC.CNC(=O)CCCCOCCCOCCN1CCCCC1 |
| InChI | InChI=1S/C16H32N2O3.C2H6/c1-17-16(19)8-3-6-12-20-13-7-14-21-15-11-18-9-4-2-5-10-18;1-2/h2-15H2,1H3,(H,17,19);1-2H3 |
| InChIKey | QOTPCBOLQCTHMD-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.51 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|