C22H24N2O9S — CID 142391725
[3,4,5-trihydroxy-6-[3-[4-[hydroxy(methoxy)methyl]-1,3-thiazole-2-carbonyl]indol-1-yl]oxan-2-yl]methyl acetate (PubChem CID 142391725) has the molecular formula C22H24N2O9S and a molecular weight of 492.51 g/mol. Its IUPAC name is [3,4,5-trihydroxy-6-[3-[4-[hydroxy(methoxy)methyl]-1,3-thiazole-2-carbonyl]indol-1-yl]oxan-2-yl]methyl acetate.
| Compound Name | [3,4,5-trihydroxy-6-[3-[4-[hydroxy(methoxy)methyl]-1,3-thiazole-2-carbonyl]indol-1-yl]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 142391725 |
| Molecular Formula | C22H24N2O9S |
| Molecular Weight | 492.51 g/mol |
| Exact Mass | 492.12 |
| IUPAC Name | [3,4,5-trihydroxy-6-[3-[4-[hydroxy(methoxy)methyl]-1,3-thiazole-2-carbonyl]indol-1-yl]oxan-2-yl]methyl acetate |
| SMILES | COC(O)c1csc(C(=O)c2cn(C3OC(COC(C)=O)C(O)C(O)C3O)c3ccccc23)n1 |
| InChI | InChI=1S/C22H24N2O9S/c1-10(25)32-8-15-17(27)18(28)19(29)21(33-15)24-7-12(11-5-3-4-6-14(11)24)16(26)20-23-13(9-34-20)22(30)31-2/h3-7,9,15,17-19,21-22,27-30H,8H2,1-2H3 |
| InChIKey | QJZAWMWHXUCQEY-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 160.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.51 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|