About methyl 4-[2-(tert-butylamino)-1,1-difluoro-2-oxoethyl]-3-chloro-1-methylpyrrole-2-carboxylate
methyl 4-[2-(tert-butylamino)-1,1-difluoro-2-oxoethyl]-3-chloro-1-methylpyrrole-2-carboxylate (PubChem CID 142392448) has the molecular formula C13H17ClF2N2O3
and a molecular weight of 322.74 g/mol. Its IUPAC name is methyl 4-[2-(tert-butylamino)-1,1-difluoro-2-oxoethyl]-3-chloro-1-methylpyrrole-2-carboxylate.
Molecular Properties
| Compound Name | methyl 4-[2-(tert-butylamino)-1,1-difluoro-2-oxoethyl]-3-chloro-1-methylpyrrole-2-carboxylate |
| PubChem CID | 142392448 |
| Molecular Formula | C13H17ClF2N2O3 |
| Molecular Weight | 322.74 g/mol |
| Exact Mass | 322.09 |
| IUPAC Name | methyl 4-[2-(tert-butylamino)-1,1-difluoro-2-oxoethyl]-3-chloro-1-methylpyrrole-2-carboxylate |
| SMILES | COC(=O)c1c(Cl)c(C(F)(F)C(=O)NC(C)(C)C)cn1C |
| InChI | InChI=1S/C13H17ClF2N2O3/c1-12(2,3)17-11(20)13(15,16)7-6-18(4)9(8(7)14)10(19)21-5/h6H,1-5H3,(H,17,20) |
| InChIKey | SJIRNOXSKGQRMA-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 60.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.74 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 4-[2-(tert-butylamino)-1,1-difluoro-2-oxoethyl]-3-chloro-1-methylpyrrole-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-[2-(tert-butylamino)-1,1-difluoro-2-oxoethyl]-3-chloro-1-methylpyrrole-2-carboxylate?
The IUPAC name of methyl 4-[2-(tert-butylamino)-1,1-difluoro-2-oxoethyl]-3-chloro-1-methylpyrrole-2-carboxylate (CID 142392448) is methyl 4-[2-(tert-butylamino)-1,1-difluoro-2-oxoethyl]-3-chloro-1-methylpyrrole-2-carboxylate.
What is the SMILES notation for methyl 4-[2-(tert-butylamino)-1,1-difluoro-2-oxoethyl]-3-chloro-1-methylpyrrole-2-carboxylate?
The canonical SMILES for methyl 4-[2-(tert-butylamino)-1,1-difluoro-2-oxoethyl]-3-chloro-1-methylpyrrole-2-carboxylate is COC(=O)c1c(Cl)c(C(F)(F)C(=O)NC(C)(C)C)cn1C.
What is the InChIKey of methyl 4-[2-(tert-butylamino)-1,1-difluoro-2-oxoethyl]-3-chloro-1-methylpyrrole-2-carboxylate?
The InChIKey is SJIRNOXSKGQRMA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17ClF2N2O3/c1-12(2,3)17-11(20)13(15,16)7-6-18(4)9(8(7)14)10(19)21-5/h6H,1-5H3,(H,17,20).
What are the key properties of methyl 4-[2-(tert-butylamino)-1,1-difluoro-2-oxoethyl]-3-chloro-1-methylpyrrole-2-carboxylate?
methyl 4-[2-(tert-butylamino)-1,1-difluoro-2-oxoethyl]-3-chloro-1-methylpyrrole-2-carboxylate has a molecular weight of 322.74 g/mol, XLogP of 2.47, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-[2-(tert-butylamino)-1,1-difluoro-2-oxoethyl]-3-chloro-1-methylpyrrole-2-carboxylate is sourced from PubChem (CID 142392448), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).