C25H25N7O4 — CID 142393069
N-[4-(but-3-ynylamino)-5-cyano-2-pyridinyl]-7-formyl-6-[(3-oxomorpholin-4-yl)methyl]-3,4-dihydro-2H-1,8-naphthyridine-1-carboxamide (PubChem CID 142393069) has the molecular formula C25H25N7O4 and a molecular weight of 487.52 g/mol. Its IUPAC name is N-[4-(but-3-ynylamino)-5-cyano-2-pyridinyl]-7-formyl-6-[(3-oxomorpholin-4-yl)methyl]-3,4-dihydro-2H-1,8-naphthyridine-1-carboxamide.
| Compound Name | N-[4-(but-3-ynylamino)-5-cyano-2-pyridinyl]-7-formyl-6-[(3-oxomorpholin-4-yl)methyl]-3,4-dihydro-2H-1,8-naphthyridine-1-carboxamide |
|---|---|
| PubChem CID | 142393069 |
| Molecular Formula | C25H25N7O4 |
| Molecular Weight | 487.52 g/mol |
| Exact Mass | 487.20 |
| IUPAC Name | N-[4-(but-3-ynylamino)-5-cyano-2-pyridinyl]-7-formyl-6-[(3-oxomorpholin-4-yl)methyl]-3,4-dihydro-2H-1,8-naphthyridine-1-carboxamide |
| SMILES | C#CCCNc1cc(NC(=O)N2CCCc3cc(CN4CCOCC4=O)c(C=O)nc32)ncc1C#N |
| InChI | InChI=1S/C25H25N7O4/c1-2-3-6-27-20-11-22(28-13-19(20)12-26)30-25(35)32-7-4-5-17-10-18(21(15-33)29-24(17)32)14-31-8-9-36-16-23(31)34/h1,10-11,13,15H,3-9,14,16H2,(H2,27,28,30,35) |
| InChIKey | ASZMXHONOCIXCJ-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 140.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.52 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|