About 3,3-dimethyl-1-[4-(morpholin-4-ylmethyl)piperidin-1-yl]butan-1-one;ethane
3,3-dimethyl-1-[4-(morpholin-4-ylmethyl)piperidin-1-yl]butan-1-one;ethane (PubChem CID 142393124) has the molecular formula C18H36N2O2
and a molecular weight of 312.50 g/mol. Its IUPAC name is 3,3-dimethyl-1-[4-(morpholin-4-ylmethyl)piperidin-1-yl]butan-1-one;ethane.
Molecular Properties
| Compound Name | 3,3-dimethyl-1-[4-(morpholin-4-ylmethyl)piperidin-1-yl]butan-1-one;ethane |
| PubChem CID | 142393124 |
| Molecular Formula | C18H36N2O2 |
| Molecular Weight | 312.50 g/mol |
| Exact Mass | 312.28 |
| IUPAC Name | 3,3-dimethyl-1-[4-(morpholin-4-ylmethyl)piperidin-1-yl]butan-1-one;ethane |
| SMILES | CC.CC(C)(C)CC(=O)N1CCC(CN2CCOCC2)CC1 |
| InChI | InChI=1S/C16H30N2O2.C2H6/c1-16(2,3)12-15(19)18-6-4-14(5-7-18)13-17-8-10-20-11-9-17;1-2/h14H,4-13H2,1-3H3;1-2H3 |
| InChIKey | FRAOTECYWDBVTR-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.50 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3,3-dimethyl-1-[4-(morpholin-4-ylmethyl)piperidin-1-yl]butan-1-one;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3-dimethyl-1-[4-(morpholin-4-ylmethyl)piperidin-1-yl]butan-1-one;ethane?
The IUPAC name of 3,3-dimethyl-1-[4-(morpholin-4-ylmethyl)piperidin-1-yl]butan-1-one;ethane (CID 142393124) is 3,3-dimethyl-1-[4-(morpholin-4-ylmethyl)piperidin-1-yl]butan-1-one;ethane.
What is the SMILES notation for 3,3-dimethyl-1-[4-(morpholin-4-ylmethyl)piperidin-1-yl]butan-1-one;ethane?
The canonical SMILES for 3,3-dimethyl-1-[4-(morpholin-4-ylmethyl)piperidin-1-yl]butan-1-one;ethane is CC.CC(C)(C)CC(=O)N1CCC(CN2CCOCC2)CC1.
What is the InChIKey of 3,3-dimethyl-1-[4-(morpholin-4-ylmethyl)piperidin-1-yl]butan-1-one;ethane?
The InChIKey is FRAOTECYWDBVTR-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H30N2O2.C2H6/c1-16(2,3)12-15(19)18-6-4-14(5-7-18)13-17-8-10-20-11-9-17;1-2/h14H,4-13H2,1-3H3;1-2H3.
What are the key properties of 3,3-dimethyl-1-[4-(morpholin-4-ylmethyl)piperidin-1-yl]butan-1-one;ethane?
3,3-dimethyl-1-[4-(morpholin-4-ylmethyl)piperidin-1-yl]butan-1-one;ethane has a molecular weight of 312.50 g/mol, XLogP of 3.02, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-dimethyl-1-[4-(morpholin-4-ylmethyl)piperidin-1-yl]butan-1-one;ethane is sourced from PubChem (CID 142393124), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).