C16H30O6 — CID 14239337
2-(3,7-dimethyloct-6-enoxy)-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 14239337) has the molecular formula C16H30O6 and a molecular weight of 318.41 g/mol. Its IUPAC name is 2-(3,7-dimethyloct-6-enoxy)-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | 2-(3,7-dimethyloct-6-enoxy)-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 14239337 |
| Molecular Formula | C16H30O6 |
| Molecular Weight | 318.41 g/mol |
| Exact Mass | 318.20 |
| IUPAC Name | 2-(3,7-dimethyloct-6-enoxy)-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | CC(C)=CCCC(C)CCOC1OC(CO)C(O)C(O)C1O |
| InChI | InChI=1S/C16H30O6/c1-10(2)5-4-6-11(3)7-8-21-16-15(20)14(19)13(18)12(9-17)22-16/h5,11-20H,4,6-9H2,1-3H3 |
| InChIKey | BGAILLKFXBSPRD-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.41 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|