C12H20N2O4 — CID 142393555
(5S)-5-amino-N-(cyclopentylmethoxy)-2,6-dioxohexanamide (PubChem CID 142393555) has the molecular formula C12H20N2O4 and a molecular weight of 256.30 g/mol. Its IUPAC name is (5S)-5-amino-N-(cyclopentylmethoxy)-2,6-dioxohexanamide.
| Compound Name | (5S)-5-amino-N-(cyclopentylmethoxy)-2,6-dioxohexanamide |
|---|---|
| PubChem CID | 142393555 |
| Molecular Formula | C12H20N2O4 |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 256.14 |
| IUPAC Name | (5S)-5-amino-N-(cyclopentylmethoxy)-2,6-dioxohexanamide |
| SMILES | N[C@H](C=O)CCC(=O)C(=O)NOCC1CCCC1 |
| InChI | InChI=1S/C12H20N2O4/c13-10(7-15)5-6-11(16)12(17)14-18-8-9-3-1-2-4-9/h7,9-10H,1-6,8,13H2,(H,14,17)/t10-/m0/s1 |
| InChIKey | KHVIFBCDXCQOGI-JTQLQIEISA-N |
| XLogP | 0.10 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.30 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|