C15H16ClFN2O — CID 142395310
5-[(4-chloro-2-fluorophenyl)methyl]-4-ethyl-6-methoxy-2-methylpyrimidine (PubChem CID 142395310) has the molecular formula C15H16ClFN2O and a molecular weight of 294.76 g/mol. Its IUPAC name is 5-[(4-chloro-2-fluorophenyl)methyl]-4-ethyl-6-methoxy-2-methylpyrimidine.
| Compound Name | 5-[(4-chloro-2-fluorophenyl)methyl]-4-ethyl-6-methoxy-2-methylpyrimidine |
|---|---|
| PubChem CID | 142395310 |
| Molecular Formula | C15H16ClFN2O |
| Molecular Weight | 294.76 g/mol |
| Exact Mass | 294.09 |
| IUPAC Name | 5-[(4-chloro-2-fluorophenyl)methyl]-4-ethyl-6-methoxy-2-methylpyrimidine |
| SMILES | CCc1nc(C)nc(OC)c1Cc1ccc(Cl)cc1F |
| InChI | InChI=1S/C15H16ClFN2O/c1-4-14-12(15(20-3)19-9(2)18-14)7-10-5-6-11(16)8-13(10)17/h5-6,8H,4,7H2,1-3H3 |
| InChIKey | JRNCFNPKJRAWQA-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.76 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |