C15H26O3 — CID 14239546
(1R,3aR,6S,8aS)-6,8a-dihydroxy-3a,6-dimethyl-1-propan-2-yl-1,2,3,4,7,8-hexahydroazulen-5-one (PubChem CID 14239546) has the molecular formula C15H26O3 and a molecular weight of 254.37 g/mol. Its IUPAC name is (1R,3aR,6S,8aS)-6,8a-dihydroxy-3a,6-dimethyl-1-propan-2-yl-1,2,3,4,7,8-hexahydroazulen-5-one.
| Compound Name | (1R,3aR,6S,8aS)-6,8a-dihydroxy-3a,6-dimethyl-1-propan-2-yl-1,2,3,4,7,8-hexahydroazulen-5-one |
|---|---|
| PubChem CID | 14239546 |
| Molecular Formula | C15H26O3 |
| Molecular Weight | 254.37 g/mol |
| Exact Mass | 254.19 |
| IUPAC Name | (1R,3aR,6S,8aS)-6,8a-dihydroxy-3a,6-dimethyl-1-propan-2-yl-1,2,3,4,7,8-hexahydroazulen-5-one |
| SMILES | CC(C)[C@H]1CC[C@]2(C)CC(=O)[C@@](C)(O)CC[C@]12O |
| InChI | InChI=1S/C15H26O3/c1-10(2)11-5-6-13(3)9-12(16)14(4,17)7-8-15(11,13)18/h10-11,17-18H,5-9H2,1-4H3/t11-,13-,14+,15+/m1/s1 |
| InChIKey | DJCIMLRKXWDVEU-RZFFKMDDSA-N |
| XLogP | 2.29 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.37 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |