C20H20F3N5O3S — CID 142395958
(Z)-1-[2-(3,8-diazabicyclo[3.2.1]octan-3-yl)-7-(1,3-thiazol-2-yl)-4-(trifluoromethoxy)-1,3-benzoxazol-5-yl]-N-methoxyethanimine (PubChem CID 142395958) has the molecular formula C20H20F3N5O3S and a molecular weight of 467.47 g/mol. Its IUPAC name is (Z)-1-[2-(3,8-diazabicyclo[3.2.1]octan-3-yl)-7-(1,3-thiazol-2-yl)-4-(trifluoromethoxy)-1,3-benzoxazol-5-yl]-N-methoxyethanimine.
| Compound Name | (Z)-1-[2-(3,8-diazabicyclo[3.2.1]octan-3-yl)-7-(1,3-thiazol-2-yl)-4-(trifluoromethoxy)-1,3-benzoxazol-5-yl]-N-methoxyethanimine |
|---|---|
| PubChem CID | 142395958 |
| Molecular Formula | C20H20F3N5O3S |
| Molecular Weight | 467.47 g/mol |
| Exact Mass | 467.12 |
| IUPAC Name | (Z)-1-[2-(3,8-diazabicyclo[3.2.1]octan-3-yl)-7-(1,3-thiazol-2-yl)-4-(trifluoromethoxy)-1,3-benzoxazol-5-yl]-N-methoxyethanimine |
| SMILES | CO/N=C(/C)c1cc(-c2nccs2)c2oc(N3CC4CCC(C3)N4)nc2c1OC(F)(F)F |
| InChI | InChI=1S/C20H20F3N5O3S/c1-10(27-29-2)13-7-14(18-24-5-6-32-18)16-15(17(13)31-20(21,22)23)26-19(30-16)28-8-11-3-4-12(9-28)25-11/h5-7,11-12,25H,3-4,8-9H2,1-2H3/b27-10- |
| InChIKey | IXBCDPKPRIRDOW-NCAUGAEKSA-N |
| XLogP | 4.16 |
| TPSA | 85.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.47 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|